Ligand name: BACTERIOCHLOROPHYLL A
PDB ligand accession: BCL
DrugBank: DB01853
PubChem: 11953947;16057436;
ChEMBL: n/a
InChI Key: DSJXIQQMORJERS-AGGZHOMASA-M
SMILES: CCC1C(C2=CC3=C(C(=C4[N-]3[Mg+2]56[N]2=C1C=C7[N-]5C8=C(C(C(=O)C8=C7C)C(=O)OC)C9=[N]6C(=C4)C(C9CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)C)C)C(=O)C)C
Drug action: n/a

ClassyFire chemical classification:

• Kingdom: Organic compounds
  • Superclass: Organoheterocyclic compounds
    • Class: Tetrapyrroles and derivatives
      • Subclass: Metallotetrapyrroles

List of PDB structures and/or AlphaFold models with target protein W0E6A1

PDB/AF Accession	PyMOL script	Experimental / Predicted	Interacting ECOD domains	ECOD X-group name	LigPlot
6ZXA	Download	Experimental	e6zxaA1 e6zxaC1 e6zxaB1 e6zxaN1 e6zxaA1 e6zxaM1 e6zxaB1 e6zxaC1 e6zxaE1 e6zxaB1 e6zxaD1 e6zxaA1 e6zxaC1 e6zxaD1 e6zxaE1 e6zxaG1 e6zxaD1 e6zxaF1 e6zxaC1 e6zxaE1 e6zxaF1 e6zxaG1 e6zxaI1 e6zxaF1 e6zxaH1 e6zxaE1 e6zxaG1 e6zxaH1 e6zxaI1 e6zxaK1 e6zxaH1 e6zxaJ1 e6zxaG1 e6zxaI1 e6zxaJ1 e6zxaK1 e6zxaM1 e6zxaJ1 e6zxaL1 e6zxaI1 e6zxaK1 e6zxaL1 e6zxaA1 e6zxaM1 e6zxaL1 e6zxaN1 e6zxaK1 e6zxaM1 e6zxaN1	Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits	LigPlot