PDB ligand accession: CLA
DrugBank: DB02133
PubChem: 12085802;13557925;16667503;44602414;
ChEMBL: n/a
InChI Key: ATNHDLDRLWWWCB-AENOIHSZSA-M
SMILES: CCC1=C(C2=Cc3c(c(c4n3[Mg]56[N]2=C1C=C7N5C8=C(C(C(=O)C8=C7C)C(=O)OC)C9=[N]6C(=C4)C(C9CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)C)C)C=C)C
Drug action: n/a
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organoheterocyclic compounds
- Class: Tetrapyrroles and derivatives
- Subclass: Chlorins
- Class: Tetrapyrroles and derivatives
- Superclass: Organoheterocyclic compounds
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| 7Y5E | Download | Experimental | e7y5eAL1 e7y5eDL1 e7y5eA61 e7y5eD61 e7y5ea61 e7y5ed61 e7y5eaL1 e7y5eiL1 e7y5eaL1 e7y5edL1 | Bacterial photosystem II reaction centre L and M subunits-like Bacterial photosystem II reaction centre L and M subunits-like Bacterial photosystem II reaction centre L and M subunits-like Bacterial photosystem II reaction centre L and M subunits-like Bacterial photosystem II reaction centre L and M subunits-like Bacterial photosystem II reaction centre L and M subunits-like Bacterial photosystem II reaction centre L and M subunits-like Photosystem II reaction center protein I, PsbI Bacterial photosystem II reaction centre L and M subunits-like Bacterial photosystem II reaction centre L and M subunits-like | LigPlot |
| 7Y7A | Download | Experimental | e7y7aA91 e7y7aD91 e7y7aa91 e7y7ai91 e7y7aAE1 e7y7aDE1 e7y7aaE1 e7y7aiE1 e7y7aAO1 e7y7aDO1 e7y7aaO1 e7y7adO1 e7y7aAZ1 e7y7aDZ1 e7y7aaZ1 e7y7adZ1 e7y7aAm1 e7y7aDm1 e7y7aam1 e7y7aim1 | Bacterial photosystem II reaction centre L and M subunits-like Bacterial photosystem II reaction centre L and M subunits-like Bacterial photosystem II reaction centre L and M subunits-like Photosystem II reaction center protein I, PsbI Bacterial photosystem II reaction centre L and M subunits-like Bacterial photosystem II reaction centre L and M subunits-like Bacterial photosystem II reaction centre L and M subunits-like Photosystem II reaction center protein I, PsbI Bacterial photosystem II reaction centre L and M subunits-like Bacterial photosystem II reaction centre L and M subunits-like Bacterial photosystem II reaction centre L and M subunits-like Bacterial photosystem II reaction centre L and M subunits-like Bacterial photosystem II reaction centre L and M subunits-like Bacterial photosystem II reaction centre L and M subunits-like Bacterial photosystem II reaction centre L and M subunits-like Bacterial photosystem II reaction centre L and M subunits-like Bacterial photosystem II reaction centre L and M subunits-like Bacterial photosystem II reaction centre L and M subunits-like Bacterial photosystem II reaction centre L and M subunits-like Photosystem II reaction center protein I, PsbI | LigPlot |