PDB ligand accession: PHO
DrugBank: n/a
PubChem: n/a
ChEMBL:
InChI Key: CQIKWXUXPNUNDV-RCBXBCQGSA-N
SMILES: CCC1=C(c2cc3c(c(c([nH]3)cc4nc(c5c6c(c(c([nH]6)cc1n2)C)C(=O)C5C(=O)OC)C(C4C)CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)C)C=C)C
Drug action: n/a
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| 7Y5E | Download | Experimental | e7y5eAL1 e7y5eDL1 e7y5eA61 e7y5eD61 e7y5ea61 e7y5ed61 e7y5eaL1 e7y5edL1 | Bacterial photosystem II reaction centre L and M subunits-like Bacterial photosystem II reaction centre L and M subunits-like Bacterial photosystem II reaction centre L and M subunits-like Bacterial photosystem II reaction centre L and M subunits-like Bacterial photosystem II reaction centre L and M subunits-like Bacterial photosystem II reaction centre L and M subunits-like Bacterial photosystem II reaction centre L and M subunits-like Bacterial photosystem II reaction centre L and M subunits-like | LigPlot |
| 7Y7A | Download | Experimental | e7y7aA91 e7y7aD91 e7y7aa91 e7y7ad91 e7y7aAE1 e7y7aDE1 e7y7aaE1 e7y7adE1 e7y7aAO1 e7y7aDO1 e7y7aaO1 e7y7adO1 e7y7aAZ1 e7y7aDZ1 e7y7aaZ1 e7y7adZ1 e7y7aAm1 e7y7aDm1 e7y7aam1 e7y7adm1 | Bacterial photosystem II reaction centre L and M subunits-like Bacterial photosystem II reaction centre L and M subunits-like Bacterial photosystem II reaction centre L and M subunits-like Bacterial photosystem II reaction centre L and M subunits-like Bacterial photosystem II reaction centre L and M subunits-like Bacterial photosystem II reaction centre L and M subunits-like Bacterial photosystem II reaction centre L and M subunits-like Bacterial photosystem II reaction centre L and M subunits-like Bacterial photosystem II reaction centre L and M subunits-like Bacterial photosystem II reaction centre L and M subunits-like Bacterial photosystem II reaction centre L and M subunits-like Bacterial photosystem II reaction centre L and M subunits-like Bacterial photosystem II reaction centre L and M subunits-like Bacterial photosystem II reaction centre L and M subunits-like Bacterial photosystem II reaction centre L and M subunits-like Bacterial photosystem II reaction centre L and M subunits-like Bacterial photosystem II reaction centre L and M subunits-like Bacterial photosystem II reaction centre L and M subunits-like Bacterial photosystem II reaction centre L and M subunits-like Bacterial photosystem II reaction centre L and M subunits-like | LigPlot |