Attributes
UniProt ID
Protein Name
Tryptophan 2,3-dioxygenase
Ligand Name
TRYPTOPHAN
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
QIVBCDIJIAJPQS-VIFPVBQESA-N
SMILES
c1ccc2c(c1)c(c[nH]2)CC(C(=O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 2NW8
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse2nw8A1e2nw8B1
ECOD domains from experimental PDB structures interacting with ligand DB00150
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q8PDA8 | DB00150 | TRP | 2nw8 | e2nw8A1 | A:23-284 |
| Q8PDA8 | DB00150 | TRP | 2nw8 | e2nw8B1 | B:23-284 |
| Q8PDA8 | DB00150 | TRP | 3bk9 | e3bk9A1 | A:7-283 |
| Q8PDA8 | DB00150 | TRP | 3bk9 | e3bk9B1 | B:7-286 |
| Q8PDA8 | DB00150 | TRP | 3bk9 | e3bk9C1 | C:7-282 |
| Q8PDA8 | DB00150 | TRP | 3bk9 | e3bk9D1 | D:22-283 |
| Q8PDA8 | DB00150 | TRP | 3bk9 | e3bk9E1 | E:23-282 |
| Q8PDA8 | DB00150 | TRP | 3bk9 | e3bk9F1 | F:23-283 |
| Q8PDA8 | DB00150 | TRP | 3bk9 | e3bk9G1 | G:21-282 |
| Q8PDA8 | DB00150 | TRP | 3bk9 | e3bk9H1 | H:22-283 |
| Q8PDA8 | DB00150 | TRP | 3e08 | e3e08A1 | A:7-286 |
| Q8PDA8 | DB00150 | TRP | 3e08 | e3e08B1 | B:7-286 |
| Q8PDA8 | DB00150 | TRP | 3e08 | e3e08C1 | C:7-286 |
| Q8PDA8 | DB00150 | TRP | 3e08 | e3e08D1 | D:7-286 |
| Q8PDA8 | DB00150 | TRP | 3e08 | e3e08E1 | E:7-284 |
| Q8PDA8 | DB00150 | TRP | 3e08 | e3e08F1 | F:7-282 |
| Q8PDA8 | DB00150 | TRP | 3e08 | e3e08G1 | G:7-283 |
| Q8PDA8 | DB00150 | TRP | 3e08 | e3e08H1 | H:7-282 |
| Q8PDA8 | DB00150 | TRP | 7p46 | e7p46A1 | A:5-285 |
| Q8PDA8 | DB00150 | TRP | 7p46 | e7p46B1 | B:6-286 |
| Q8PDA8 | DB00150 | TRP | 7p46 | e7p46C1 | C:6-284 |
| Q8PDA8 | DB00150 | TRP | 7p46 | e7p46D1 | D:6-285 |
| Q8PDA8 | DB00150 | TRP | 7p46 | e7p46E1 | E:6-283 |
| Q8PDA8 | DB00150 | TRP | 7p46 | e7p46F1 | F:5-283 |
| Q8PDA8 | DB00150 | TRP | 7p46 | e7p46G1 | G:6-282 |
| Q8PDA8 | DB00150 | TRP | 7p46 | e7p46H1 | H:5-284 |