Ligand name: SPIRONOLACTONE
PDB ligand accession: SNL
DrugBank: DB00421
PubChem: 5833
ChEMBL: CHEMBL1393
InChI Key: LXMSZDCAJNLERA-ZHYRCANASA-N
SMILES: CC(=O)SC1CC2=CC(=O)CCC2(C3C1C4CCC5(C4(CC3)C)CCC(=O)O5)C

ClassyFire chemical classification:

List of proteins that are targets for DB00421

# DrugDomain Data UniProt Accession Protein name Drug Action Affinity data
1 P04278_SNL P04278 Sex hormone-binding globulin n/a
2 P19099_SNL P19099 Cytochrome P450 11B2, n/a
3 O75469_SNL O75469 Nuclear receptor subfamily agonist
4 P08235_SNL P08235 Mineralocorticoid receptor (MR) antagonist Ki(nM) = 2.323
IC50(nM) = 1.6
5 P10275_SNL P10275 Androgen receptor (Dihydrotestosterone antagonist Ki(nM) = 39.4
IC50(nM) = 48.0
EC50(nM) = 20000.0
6 P05093_SNL P05093 Steroid 17-alpha-hydroxylase/17,20 lyase n/a
7 P04150_SNL P04150 Glucocorticoid receptor (GR) antagonist Ki(nM) = 32.6
IC50(nM) = 1400.0
EC50(nM) = 20000.0
8 P06401_SNL P06401 Progesterone receptor (PR) agonist Ki(nM) = 399.7
IC50(nM) = 650.0
EC50(nM) = 20000.0