PDB ligand accession: TRT
DrugBank: DB02080
PubChem:
ChEMBL: n/a
InChI Key: HEUDUECKTWTQQR-UHFFFAOYSA-N
SMILES: CC(C)(C)CC(C)(C)c1ccc(cc1)OCCOCCOCCOC
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Benzenoids
- Class: Benzene and substituted derivatives
- Subclass: Phenylpropanes
- Class: Benzene and substituted derivatives
- Superclass: Benzenoids
| # | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
|---|---|---|---|---|---|
| 1 | P49638_TRT | P49638 | Alpha-tocopherol transfer protein | n/a | |
| 2 | P32340_TRT | P32340 | Rotenone-insensitive NADH-ubiquinone oxidoreductase, | n/a | |
| 3 | Q1RP79_TRT | Q1RP79 | Basic phospholipase A2 | n/a | |
| 4 | Q06KA2_TRT | Q06KA2 | Long form salivary | n/a | |
| 5 | V5H924_TRT | V5H924 | Putative tick cistatins | n/a | |
| 6 | Q8I302_TRT | Q8I302 | NADH:ubiquinone reductase (non-electrogenic) | n/a | |
| 7 | P03146_TRT | P03146 | Capsid protein (Core | n/a | |
| 8 | P51659_TRT | P51659 | Peroxisomal multifunctional enzyme | n/a | |
| 9 | D5GA36_TRT | D5GA36 | (Perigord truffle) hypothetical | n/a | |
| 10 | P00803_TRT | P00803 | Signal peptidase I | n/a | |
| 11 | P14555_TRT | P14555 | Phospholipase A2, membrane | n/a |