PDB ligand accession: FMX
DrugBank: DB07778
PubChem:
ChEMBL:
InChI Key: PCCSBWNGDMYFCW-QFIPXVFZSA-N
SMILES: CC1(C(=O)N(C(=O)O1)Nc2ccccc2)c3ccc(cc3)Oc4ccccc4
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Benzenoids
- Class: Benzene and substituted derivatives
- Subclass: Diphenylethers
- Class: Benzene and substituted derivatives
- Superclass: Benzenoids
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | P14927_FMX | P14927 | Cytochrome b-c1 complex | n/a | |
2 | P08574_FMX | P08574 | Cytochrome c1, heme | n/a | |
3 | P22695_FMX | P22695 | Cytochrome b-c1 complex | n/a | |
4 | Q02762_FMX | Q02762 | Ubiquinol-cytochrome c reductase | n/a | |
5 | Q02761_FMX | Q02761 | Cytochrome b | n/a | |
6 | P00156_FMX | P00156 | Cytochrome b (Complex | n/a | |
7 | P47985_FMX | P47985 | Cytochrome b-c1 complex | n/a | |
8 | P18946_FMX | P18946 | Cytochrome b (Complex | n/a | |
9 | P00157_FMX | P00157 | Cytochrome b (Complex | n/a | |
10 | P31930_FMX | P31930 | Cytochrome b-c1 complex | n/a |