PDB ligand accession: Q4J
DrugBank: DB15822
PubChem: n/a
ChEMBL:
InChI Key: GBLBJPZSROAGMF-BATDWUPUSA-N
SMILES: Cc1cc(n[nH]1)Nc2cc(nc(n2)C3CCC(CC3)(C(=O)NC(C)c4ccc(nc4)n5cc(cn5)F)OC)C
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organoheterocyclic compounds
- Class: Pyridines and derivatives
- Subclass: Pyrazolylpyridines
- Class: Pyridines and derivatives
- Superclass: Organoheterocyclic compounds
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | Q16288_Q4J | Q16288 | NT-3 growth factor | inhibitor | |
2 | P11362_Q4J | P11362 | Fibroblast growth factor | inhibitor | |
3 | Q08345_Q4J | Q08345 | Epithelial discoidin domain-containing | inhibitor | |
4 | O60674_Q4J | O60674 | Tyrosine-protein kinase JAK2 | inhibitor | |
5 | P04629_Q4J | P04629 | High affinity nerve | inhibitor | |
6 | P23458_Q4J | P23458 | Tyrosine-protein kinase JAK1 | inhibitor | |
7 | P21802_Q4J | P21802 | Fibroblast growth factor | inhibitor | |
8 | P36888_Q4J | P36888 | Receptor-type tyrosine-protein kinase | inhibitor | |
9 | P07949_Q4J | P07949 | Proto-oncogene tyrosine-protein kinase | inhibitor | |
10 | P09619_Q4J | P09619 | Platelet-derived growth factor | inhibitor | |
11 | P35968_Q4J | P35968 | Vascular endothelial growth | inhibitor |