Ligand name: N,N-diethyl-N'-[(8alpha)-6-methyl-9,10-didehydroergolin-8-yl]urea
PDB ligand accession: H8G
DrugBank: DB00589
PubChem: 28864
ChEMBL: CHEMBL157138
InChI Key: BKRGVLQUQGGVSM-KBXCAEBGSA-N
SMILES: CCN(CC)C(=O)NC1CN(C2Cc3c[nH]c4c3c(ccc4)C2=C1)C

ClassyFire chemical classification:

List of proteins that are targets for H8G

# DrugDomain Data UniProt Accession Protein name Drug Action Affinity data
1 P28335_H8G P28335 5-hydroxytryptamine receptor 2C agonist Ki(nM) = 10000.0
IC50(nM) = 26.0
Kd(nM) = 50119.0
EC50(nM) = 203.1
2 P28221_H8G P28221 5-hydroxytryptamine receptor 1D agonist Ki(nM) = 10000.0
3 P34969_H8G P34969 5-hydroxytryptamine receptor 7 n/a Ki(nM) = 6.8
4 P18825_H8G P18825 Alpha-2C adrenergic receptor other/unknown Ki(nM) = 0.4
5 P08908_H8G P08908 5-hydroxytryptamine receptor 1A agonist Ki(nM) = 0.3
Kd(nM) = 501.0
6 P28223_H8G P28223 5-hydroxytryptamine receptor 2A agonist Ki(nM) = 5.4
IC50(nM) = 0.97
EC50(nM) = 343.0
7 P14416_H8G P14416 D(2) dopamine receptor agonist Ki(nM) = 0.34
8 P21917_H8G P21917 D(4) dopamine receptor agonist Ki(nM) = 3.8
EC50(nM) = 89.0
9 P21918_H8G P21918 D(1B) dopamine receptor antagonist Ki(nM) = 77.0
10 P08913_H8G P08913 Alpha-2A adrenergic receptor other/unknown Ki(nM) = 1.8
11 P18089_H8G P18089 Alpha-2B adrenergic receptor other/unknown Ki(nM) = 0.5
12 P47898_H8G P47898 5-hydroxytryptamine receptor 5A n/a Ki(nM) = 3.1
13 P28222_H8G P28222 5-hydroxytryptamine receptor 1B agonist Ki(nM) = 16.0
14 P41595_H8G P41595 5-hydroxytryptamine receptor 2B antagonist Ki(nM) = 1.1
15 P35462_H8G P35462 D(3) dopamine receptor agonist Ki(nM) = 1.7
16 P21728_H8G P21728 D(1A) dopamine receptor antagonist Ki(nM) = 0.34