Attributes
UniProt ID
Protein Name
Na-translocating NADH-quinone reductase subunit F -NQR subunit F) -translocating NQR subunit F
Ligand Name
FLAVIN-ADENINE DINUCLEOTIDE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
VWWQXMAJTJZDQX-UYBVJOGSSA-N
SMILES
Cc1cc2c(cc1C)N(C3=NC(=O)NC(=O)C3=N2)CC(C(C(COP(=O)(O)OP(=O)(O)OCC4C(C(C(O4)n5cnc6c5ncnc6N)O)O)O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 8A1T
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse8a1tB1e8a1tC1e8a1tD1e8a1tE1e8a1tF1e8a1tF2e8a1tF3
ECOD domains from experimental PDB structures interacting with ligand DB03147
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| A0A085ST13 | DB03147 | FAD | 8a1t | e8a1tF1 | F:269-406 |
| A0A085ST13 | DB03147 | FAD | 8a1t | e8a1tF2 | F:2-127 |
| A0A085ST13 | DB03147 | FAD | 8a1t | e8a1tF3 | F:128-268 |
| A0A085ST13 | DB03147 | FAD | 8a1v | e8a1vF1 | F:269-407 |
| A0A085ST13 | DB03147 | FAD | 8a1v | e8a1vF2 | F:2-127 |
| A0A085ST13 | DB03147 | FAD | 8a1v | e8a1vF3 | F:128-268 |
| A0A085ST13 | DB03147 | FAD | 8a1w | e8a1wF1 | F:2-127 |
| A0A085ST13 | DB03147 | FAD | 8a1w | e8a1wF2 | F:269-407 |
| A0A085ST13 | DB03147 | FAD | 8a1w | e8a1wF3 | F:128-268 |
| A0A085ST13 | DB03147 | FAD | 8a1x | e8a1xF1 | F:128-268 |
| A0A085ST13 | DB03147 | FAD | 8a1x | e8a1xF2 | F:2-127 |
| A0A085ST13 | DB03147 | FAD | 8a1x | e8a1xF3 | F:269-408 |
| A0A085ST13 | DB03147 | FAD | 8a1y | e8a1yF1 | F:128-268 |
| A0A085ST13 | DB03147 | FAD | 8a1y | e8a1yF2 | F:269-408 |
| A0A085ST13 | DB03147 | FAD | 8a1y | e8a1yF3 | F:1-127 |
| A0A085ST13 | DB03147 | FAD | 8acw | e8acwF1 | F:128-268 |
| A0A085ST13 | DB03147 | FAD | 8acw | e8acwF2 | F:1-127 |
| A0A085ST13 | DB03147 | FAD | 8acw | e8acwF3 | F:269-407 |
| A0A085ST13 | DB03147 | FAD | 8acy | e8acyF1 | F:128-268 |
| A0A085ST13 | DB03147 | FAD | 8acy | e8acyF2 | F:1-127 |
| A0A085ST13 | DB03147 | FAD | 8acy | e8acyF3 | F:269-407 |
| A0A085ST13 | DB03147 | FAD | 8ad0 | e8ad0F1 | F:269-406 |
| A0A085ST13 | DB03147 | FAD | 8ad0 | e8ad0F3 | F:128-268 |