Attributes
UniProt ID
Protein Name
Cell division protein
Ligand Name
ADENOSINE-5'-TRIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
ZKHQWZAMYRWXGA-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 6YAR
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse6yarA1e6yarB1
ECOD domains from experimental PDB structures interacting with ligand DB00171
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| A0A0B1KWQ0 | DB00171 | ATP | 6yar | e6yarA1 | A:2-243 |
| A0A0B1KWQ0 | DB00171 | ATP | 6yar | e6yarB1 | B:2-241 |
| A0A0B1KWQ0 | DB00171 | ATP | 6yay | e6yayA1 | A:2-242 |
| A0A0B1KWQ0 | DB00171 | ATP | 6yay | e6yayB1 | B:2-240 |
| A0A0B1KWQ0 | DB00171 | ATP | 6yb3 | e6yb3A1 | A:2-243 |
| A0A0B1KWQ0 | DB00171 | ATP | 6yb3 | e6yb3B1 | B:2-241 |
| A0A0B1KWQ0 | DB00171 | ATP | 6yb5 | e6yb5A1 | A:2-244 |
| A0A0B1KWQ0 | DB00171 | ATP | 6yb5 | e6yb5B1 | B:2-244 |
| A0A0B1KWQ0 | DB00171 | ATP | 6ybb | e6ybbA1 | A:2-244 |
| A0A0B1KWQ0 | DB00171 | ATP | 6ybb | e6ybbB1 | B:2-244 |
| A0A0B1KWQ0 | DB00171 | ATP | 6ybu | e6ybuA1 | A:2-241 |
| A0A0B1KWQ0 | DB00171 | ATP | 6ybu | e6ybuB1 | B:2-241 |
| A0A0B1KWQ0 | DB00171 | ATP | 6ybu | e6ybuG1 | G:2-241 |
| A0A0B1KWQ0 | DB00171 | ATP | 6ybu | e6ybuH1 | H:2-240 |