Attributes
UniProt ID
Protein Name
Aminotransferase
Ligand Name
PYRIDOXAL-5'-PHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
NGVDGCNFYWLIFO-UHFFFAOYSA-N
SMILES
Cc1c(c(c(cn1)COP(=O)(O)O)C=O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 6U78
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse6u78A1e6u78A2e6u78B1e6u78B2e6u78C1e6u78C2e6u78D1e6u78D2
ECOD domains from experimental PDB structures interacting with ligand DB00114
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| A0A0E8TWE4 | DB00114 | PLP | 6u78 | e6u78A1 | A:7-318 |
| A0A0E8TWE4 | DB00114 | PLP | 6u78 | e6u78A2 | A:319-425 |
| A0A0E8TWE4 | DB00114 | PLP | 6u78 | e6u78B1 | B:2-318 |
| A0A0E8TWE4 | DB00114 | PLP | 6u78 | e6u78B2 | B:319-422 |
| A0A0E8TWE4 | DB00114 | PLP | 6u78 | e6u78C1 | C:319-424 |
| A0A0E8TWE4 | DB00114 | PLP | 6u78 | e6u78C2 | C:8-318 |
| A0A0E8TWE4 | DB00114 | PLP | 6u78 | e6u78D1 | D:319-426 |
| A0A0E8TWE4 | DB00114 | PLP | 6u78 | e6u78D2 | D:8-318 |
| A0A0E8TWE4 | DB00114 | PLP | 6u7a | e6u7aC1 | C:2-318 |
| A0A0E8TWE4 | DB00114 | PLP | 6u7a | e6u7aD2 | D:2-318 |
| A0A0E8TWE4 | DB00114 | PLP | 6u7a | e6u7aE1 | E:319-424 |
| A0A0E8TWE4 | DB00114 | PLP | 6u7a | e6u7aE2 | E:2-318 |
| A0A0E8TWE4 | DB00114 | PLP | 6u7a | e6u7aF1 | F:319-424 |
| A0A0E8TWE4 | DB00114 | PLP | 6u7a | e6u7aF2 | F:3-318 |
| A0A0E8TWE4 | DB00114 | PLP | 6u7a | e6u7aG2 | G:2-318 |
| A0A0E8TWE4 | DB00114 | PLP | 6u7a | e6u7aH1 | H:319-423 |
| A0A0E8TWE4 | DB00114 | PLP | 6u7a | e6u7aH2 | H:8-318 |