Attributes
UniProt ID
Protein Name
Ribulose bisphosphate carboxylase
Ligand Name
2-CARBOXYARABINITOL-1,5-DIPHOSPHATE
DrugBank ID
None
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
ITHCSGCUQDMYAI-ZMIZWQJLSA-N
SMILES
C(C(C(C(COP(=O)(O)O)(C(=O)O)O)O)O)OP(=O)(O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 7T1J
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse7t1jA1e7t1jA2e7t1jB1e7t1jB2e7t1jC1e7t1jC2e7t1jD1e7t1jD2e7t1jE1e7t1jE2e7t1jF1e7t1jF2e7t1jG1e7t1jG2e7t1jH1e7t1jH2e7t1jI1e7t1jI2e7t1jJ1e7t1jJ2e7t1jK1e7t1jK2e7t1jL1e7t1jL2
ECOD domains from experimental PDB structures interacting with ligand CAP
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| A0A0F2R9T6 | n/a | CAP | 7t1j | e7t1jA1 | A:138-455 |
| A0A0F2R9T6 | n/a | CAP | 7t1j | e7t1jA2 | A:1-137 |
| A0A0F2R9T6 | n/a | CAP | 7t1j | e7t1jB1 | B:138-457 |
| A0A0F2R9T6 | n/a | CAP | 7t1j | e7t1jB2 | B:1-137 |
| A0A0F2R9T6 | n/a | CAP | 7t1j | e7t1jC1 | C:138-454 |
| A0A0F2R9T6 | n/a | CAP | 7t1j | e7t1jC2 | C:1-137 |
| A0A0F2R9T6 | n/a | CAP | 7t1j | e7t1jD1 | D:138-453 |
| A0A0F2R9T6 | n/a | CAP | 7t1j | e7t1jD2 | D:2-137 |
| A0A0F2R9T6 | n/a | CAP | 7t1j | e7t1jE1 | E:138-454 |
| A0A0F2R9T6 | n/a | CAP | 7t1j | e7t1jE2 | E:2-137 |
| A0A0F2R9T6 | n/a | CAP | 7t1j | e7t1jF1 | F:138-455 |
| A0A0F2R9T6 | n/a | CAP | 7t1j | e7t1jF2 | F:2-137 |
| A0A0F2R9T6 | n/a | CAP | 7t1j | e7t1jG1 | G:1-137 |
| A0A0F2R9T6 | n/a | CAP | 7t1j | e7t1jG2 | G:138-453 |
| A0A0F2R9T6 | n/a | CAP | 7t1j | e7t1jH1 | H:138-456 |
| A0A0F2R9T6 | n/a | CAP | 7t1j | e7t1jH2 | H:3-137 |
| A0A0F2R9T6 | n/a | CAP | 7t1j | e7t1jI1 | I:2-137 |
| A0A0F2R9T6 | n/a | CAP | 7t1j | e7t1jI2 | I:138-453 |
| A0A0F2R9T6 | n/a | CAP | 7t1j | e7t1jJ1 | J:2-137 |
| A0A0F2R9T6 | n/a | CAP | 7t1j | e7t1jJ2 | J:138-455 |
| A0A0F2R9T6 | n/a | CAP | 7t1j | e7t1jK1 | K:138-453 |
| A0A0F2R9T6 | n/a | CAP | 7t1j | e7t1jK2 | K:1-137 |
| A0A0F2R9T6 | n/a | CAP | 7t1j | e7t1jL1 | L:138-453 |
| A0A0F2R9T6 | n/a | CAP | 7t1j | e7t1jL2 | L:2-137 |