Attributes
UniProt ID
Protein Name
UDP-4-amino-4-deoxy-L-arabinose--oxoglutarate aminotransferase aminotransferase
Ligand Name
PYRIDOXAL-5'-PHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
NGVDGCNFYWLIFO-UHFFFAOYSA-N
SMILES
Cc1c(c(c(cn1)COP(=O)(O)O)C=O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 8SNG
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse8sngA1e8sngA2e8sngB1e8sngB2
ECOD domains from experimental PDB structures interacting with ligand DB00114
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| A0A0H3FL22 | DB00114 | PLP | 8sng | e8sngA1 | A:1-242 |
| A0A0H3FL22 | DB00114 | PLP | 8sng | e8sngA2 | A:243-377 |
| A0A0H3FL22 | DB00114 | PLP | 8sng | e8sngB1 | B:3-242 |
| A0A0H3FL22 | DB00114 | PLP | 8sng | e8sngB2 | B:243-377 |
| A0A0H3FL22 | DB00114 | PLP | 8snj | e8snjA1 | A:243-377 |
| A0A0H3FL22 | DB00114 | PLP | 8snj | e8snjA2 | A:1-242 |
| A0A0H3FL22 | DB00114 | PLP | 8snj | e8snjB1 | B:2-242 |
| A0A0H3FL22 | DB00114 | PLP | 8snj | e8snjB2 | B:243-377 |
| A0A0H3FL22 | DB00114 | PLP | 8snj | e8snjC1 | C:3-242 |
| A0A0H3FL22 | DB00114 | PLP | 8snj | e8snjC2 | C:243-377 |
| A0A0H3FL22 | DB00114 | PLP | 8snj | e8snjD1 | D:1-242 |
| A0A0H3FL22 | DB00114 | PLP | 8snj | e8snjD2 | D:243-377 |
| A0A0H3FL22 | DB00114 | PLP | 8snj | e8snjE1 | E:243-377 |
| A0A0H3FL22 | DB00114 | PLP | 8snj | e8snjE2 | E:3-242 |
| A0A0H3FL22 | DB00114 | PLP | 8snj | e8snjF1 | F:243-377 |
| A0A0H3FL22 | DB00114 | PLP | 8snj | e8snjF2 | F:1-242 |
| A0A0H3FL22 | DB00114 | PLP | 8su6 | e8su6A1 | A:1-249 |
| A0A0H3FL22 | DB00114 | PLP | 8su6 | e8su6A2 | A:250-384 |
| A0A0H3FL22 | DB00114 | PLP | 8su6 | e8su6B1 | B:250-384 |
| A0A0H3FL22 | DB00114 | PLP | 8su6 | e8su6B2 | B:3-249 |