Attributes
UniProt ID
Protein Name
ATP synthase subunit alpha
Ligand Name
ADENOSINE-5'-DIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
XTWYTFMLZFPYCI-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 6N2Y
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse6n2yA1e6n2yA2e6n2yA3e6n2yB1e6n2yB2e6n2yB3e6n2yC1e6n2yC2e6n2yC3e6n2yD1e6n2yD2e6n2yD3e6n2yE1e6n2yE2e6n2yE3e6n2yF1e6n2yF2e6n2yF3e6n2yG1e6n2yH1e6n2yH2e6n2yI1e6n2ya1e6n2yb11e6n2yb21e6n2yc01e6n2yc11e6n2yc21e6n2yc31e6n2yc41e6n2yc51e6n2yc61e6n2yc71e6n2yc81e6n2yc91
ECOD domains from experimental PDB structures interacting with ligand DB16833
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| A0A0M3VGF9 | DB16833 | ADP | 6n2y | e6n2yB3 | B:96-371 |
| A0A0M3VGF9 | DB16833 | ADP | 6n2z | e6n2zC2 | C:96-371 |
| A0A0M3VGF9 | DB16833 | ADP | 6n30 | e6n30A2 | A:96-371 |
| A0A0M3VGF9 | DB16833 | ADP | 6n30 | e6n30A3 | A:372-501 |
| A0A0M3VGF9 | DB16833 | ADP | 7l1q | e7l1qC1 | C:95-372 |
| A0A0M3VGF9 | DB16833 | ADP | 7xkp | e7xkpB1 | B:96-371 |
| A0A0M3VGF9 | DB16833 | ADP | 7xkq | e7xkqC1 | C:96-371 |
| A0A0M3VGF9 | DB16833 | ADP | 7xkq | e7xkqC2 | C:372-501 |
| A0A0M3VGF9 | DB16833 | ADP | 7xkr | e7xkrB3 | B:96-371 |
| A0A0M3VGF9 | DB16833 | ADP | 8hh2 | e8hh2C3 | C:96-371 |
| A0A0M3VGF9 | DB16833 | ADP | 8hh3 | e8hh3C1 | C:96-371 |
| A0A0M3VGF9 | DB16833 | ADP | 8hh3 | e8hh3C3 | C:372-501 |
| A0A0M3VGF9 | DB16833 | ADP | 8hh4 | e8hh4C3 | C:96-371 |
| A0A0M3VGF9 | DB16833 | ADP | 8hh5 | e8hh5C3 | C:96-371 |
| A0A0M3VGF9 | DB16833 | ADP | 8hh6 | e8hh6C2 | C:96-371 |
| A0A0M3VGF9 | DB16833 | ADP | 8hh7 | e8hh7C2 | C:372-501 |
| A0A0M3VGF9 | DB16833 | ADP | 8hh7 | e8hh7C3 | C:96-371 |
| A0A0M3VGF9 | DB16833 | ADP | 8hh8 | e8hh8C1 | C:96-371 |
| A0A0M3VGF9 | DB16833 | ADP | 8hh9 | e8hh9C3 | C:96-371 |
| A0A0M3VGF9 | DB16833 | ADP | 8hha | e8hhaC3 | C:96-371 |
| A0A0M3VGF9 | DB16833 | ADP | 8hhb | e8hhbC3 | C:96-371 |