Attributes
UniProt ID
Protein Name
Serine hydroxymethyltransferase
Ligand Name
N-[4-({[(6S)-2-amino-5-formyl-4-oxo-3,4,5,6,7,8-hexahydropteridin-6-yl]methyl}amino)benzoyl]-L-glutamic acid
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
VVIAGPKUTFNRDU-STQMWFEESA-N
SMILES
c1cc(ccc1C(=O)NC(CCC(=O)O)C(=O)O)NCC2CNC3=C(N2C=O)C(=O)NC(=N3)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 8DSK
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse8dskA1e8dskA2e8dskB1e8dskB2e8dskC1e8dskC2e8dskD1e8dskD2
ECOD domains from experimental PDB structures interacting with ligand DB11596
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| A0A0R0IK90 | DB11596 | FFO | 8dsk | e8dskA1 | A:309-471 |
| A0A0R0IK90 | DB11596 | FFO | 8dsk | e8dskA2 | A:0-308 |
| A0A0R0IK90 | DB11596 | FFO | 8dsk | e8dskB1 | B:0-308 |
| A0A0R0IK90 | DB11596 | FFO | 8dsk | e8dskB2 | B:309-471 |
| A0A0R0IK90 | DB11596 | FFO | 8dsk | e8dskC1 | C:0-308 |
| A0A0R0IK90 | DB11596 | FFO | 8dsk | e8dskC2 | C:309-471 |
| A0A0R0IK90 | DB11596 | FFO | 8dsk | e8dskD1 | D:309-471 |
| A0A0R0IK90 | DB11596 | FFO | 8dsk | e8dskD2 | D:0-308 |
| A0A0R0IK90 | DB11596 | FFO | 8fsd | e8fsdA1 | A:0-308 |
| A0A0R0IK90 | DB11596 | FFO | 8fsd | e8fsdA2 | A:309-471 |
| A0A0R0IK90 | DB11596 | FFO | 8fsd | e8fsdB1 | B:309-471 |
| A0A0R0IK90 | DB11596 | FFO | 8fsd | e8fsdB2 | B:0-308 |
| A0A0R0IK90 | DB11596 | FFO | 8fsd | e8fsdC1 | C:0-308 |
| A0A0R0IK90 | DB11596 | FFO | 8fsd | e8fsdC2 | C:309-471 |
| A0A0R0IK90 | DB11596 | FFO | 8fsd | e8fsdD1 | D:0-308 |
| A0A0R0IK90 | DB11596 | FFO | 8fsd | e8fsdD2 | D:309-471 |