Attributes
UniProt ID
Protein Name
Tubulin beta chain
Ligand Name
GUANOSINE-5'-TRIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
XKMLYUALXHKNFT-UUOKFMHZSA-N
SMILES
c1nc2c(n1C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O)N=C(NC2=O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 5C8Y
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse5c8yA1e5c8yA2e5c8yB1e5c8yB2e5c8yC1e5c8yC2e5c8yD1e5c8yD2e5c8yE1e5c8yF1
ECOD domains from experimental PDB structures interacting with ligand DB04137
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| A0A0R4I995 | DB04137 | GTP | 5c8y | e5c8yB1 | B:244-428 |
| A0A0R4I995 | DB04137 | GTP | 5c8y | e5c8yD2 | D:244-431 |
| A0A0R4I995 | DB04137 | GTP | 5cb4 | e5cb4B1 | B:244-428 |
| A0A0R4I995 | DB04137 | GTP | 5cb4 | e5cb4D1 | D:244-431 |
| A0A0R4I995 | DB04137 | GTP | 5xhc | e5xhcB2 | B:244-428 |
| A0A0R4I995 | DB04137 | GTP | 5xhc | e5xhcD1 | D:244-431 |
| A0A0R4I995 | DB04137 | GTP | 5xhc | e5xhcD2 | D:1-243 |
| A0A0R4I995 | DB04137 | GTP | 5xi5 | e5xi5B1 | B:244-428 |
| A0A0R4I995 | DB04137 | GTP | 5xi5 | e5xi5D1 | D:1-243 |
| A0A0R4I995 | DB04137 | GTP | 5xi5 | e5xi5D2 | D:244-431 |
| A0A0R4I995 | DB04137 | GTP | 5xi7 | e5xi7B1 | B:244-428 |
| A0A0R4I995 | DB04137 | GTP | 5xi7 | e5xi7D1 | D:244-431 |
| A0A0R4I995 | DB04137 | GTP | 5xi7 | e5xi7D2 | D:1-243 |
| A0A0R4I995 | DB04137 | GTP | 5yl4 | e5yl4B1 | B:244-428 |
| A0A0R4I995 | DB04137 | GTP | 5yl4 | e5yl4D1 | D:244-431 |
| A0A0R4I995 | DB04137 | GTP | 5yl4 | e5yl4D2 | D:1-243 |