Attributes
UniProt ID
Protein Name
Acyl-CoA hydrolase
Ligand Name
GUANOSINE-5'-DIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
QGWNDRXFNXRZMB-UUOKFMHZSA-N
SMILES
c1nc2c(n1C3C(C(C(O3)COP(=O)(O)OP(=O)(O)O)O)O)N=C(NC2=O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 5SZY
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse5szyA1e5szyB1e5szyC1e5szyD1
ECOD domains from experimental PDB structures interacting with ligand DB04315
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| A0A0Y5D4F5 | DB04315 | GDP | 5szy | e5szyA1 | A:5-159 |
| A0A0Y5D4F5 | DB04315 | GDP | 5szy | e5szyB1 | B:5-151 |
| A0A0Y5D4F5 | DB04315 | GDP | 5szy | e5szyC1 | C:5-158 |
| A0A0Y5D4F5 | DB04315 | GDP | 5szy | e5szyD1 | D:5-158 |
| A0A0Y5D4F5 | DB04315 | GDP | 5szz | e5szzA1 | A:5-152 |
| A0A0Y5D4F5 | DB04315 | GDP | 5szz | e5szzB1 | B:5-152 |
| A0A0Y5D4F5 | DB04315 | GDP | 5szz | e5szzC1 | C:5-152 |
| A0A0Y5D4F5 | DB04315 | GDP | 5szz | e5szzD1 | D:5-152 |
| A0A0Y5D4F5 | DB04315 | GDP | 5t02 | e5t02A1 | A:5-150 |
| A0A0Y5D4F5 | DB04315 | GDP | 5t02 | e5t02B1 | B:7-153 |
| A0A0Y5D4F5 | DB04315 | GDP | 5t02 | e5t02C1 | C:5-154 |
| A0A0Y5D4F5 | DB04315 | GDP | 5t02 | e5t02D1 | D:4-151 |
| A0A0Y5D4F5 | DB04315 | GDP | 5t02 | e5t02E1 | E:5-151 |
| A0A0Y5D4F5 | DB04315 | GDP | 5t02 | e5t02F1 | F:7-151 |
| A0A0Y5D4F5 | DB04315 | GDP | 5v3a | e5v3aA1 | A:5-158 |
| A0A0Y5D4F5 | DB04315 | GDP | 5v3a | e5v3aB1 | B:5-158 |
| A0A0Y5D4F5 | DB04315 | GDP | 5v3a | e5v3aC1 | C:5-158 |
| A0A0Y5D4F5 | DB04315 | GDP | 5v3a | e5v3aD1 | D:5-158 |