Attributes
UniProt ID
Protein Name
alpha,alpha-trehalose-phosphate synthase
Ligand Name
ADENOSINE-5'-DIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
XTWYTFMLZFPYCI-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 5JIO
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse5jioA1e5jioA2
ECOD domains from experimental PDB structures interacting with ligand DB16833
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| A0A117IMA6 | DB16833 | ADP | 5jio | e5jioA1 | A:247-477 |
| A0A117IMA6 | DB16833 | ADP | 5jio | e5jioA2 | A:7-246 |
| A0A117IMA6 | DB16833 | ADP | 5l3k | e5l3kA1 | A:247-477 |
| A0A117IMA6 | DB16833 | ADP | 5l3k | e5l3kA2 | A:10-246 |
| A0A117IMA6 | DB16833 | ADP | 5l3k | e5l3kB1 | B:247-477 |
| A0A117IMA6 | DB16833 | ADP | 5l3k | e5l3kB2 | B:10-246 |
| A0A117IMA6 | DB16833 | ADP | 5l3k | e5l3kC1 | C:10-246 |
| A0A117IMA6 | DB16833 | ADP | 5l3k | e5l3kC2 | C:247-475 |
| A0A117IMA6 | DB16833 | ADP | 5l3k | e5l3kD1 | D:9-246 |
| A0A117IMA6 | DB16833 | ADP | 5l3k | e5l3kD2 | D:247-477 |
| A0A117IMA6 | DB16833 | ADP | 5l3k | e5l3kE1 | E:247-477 |
| A0A117IMA6 | DB16833 | ADP | 5l3k | e5l3kE2 | E:9-246 |
| A0A117IMA6 | DB16833 | ADP | 5l3k | e5l3kF1 | F:247-477 |
| A0A117IMA6 | DB16833 | ADP | 5l3k | e5l3kF2 | F:9-246 |
| A0A117IMA6 | DB16833 | ADP | 5l3k | e5l3kG1 | G:247-475 |
| A0A117IMA6 | DB16833 | ADP | 5l3k | e5l3kG2 | G:10-18,G:41-246 |
| A0A117IMA6 | DB16833 | ADP | 5l3k | e5l3kH1 | H:9-246 |
| A0A117IMA6 | DB16833 | ADP | 5l3k | e5l3kH2 | H:247-477 |