Attributes
UniProt ID
Protein Name
Cystathione gamma lyase, putative
Ligand Name
PYRIDOXAL-5'-PHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
NGVDGCNFYWLIFO-UHFFFAOYSA-N
SMILES
Cc1c(c(c(cn1)COP(=O)(O)O)C=O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 7NL1
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse7nl1A1e7nl1A2e7nl1B1e7nl1B2e7nl1C1e7nl1C2e7nl1D1e7nl1D2e7nl1E1e7nl1E2e7nl1F1e7nl1F2e7nl1G1e7nl1G2e7nl1H1e7nl1H2
ECOD domains from experimental PDB structures interacting with ligand DB00114
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| A0A125YN40 | DB00114 | PLP | 7nl1 | e7nl1A1 | A:281-417 |
| A0A125YN40 | DB00114 | PLP | 7nl1 | e7nl1A2 | A:21-280 |
| A0A125YN40 | DB00114 | PLP | 7nl1 | e7nl1B1 | B:281-417 |
| A0A125YN40 | DB00114 | PLP | 7nl1 | e7nl1B2 | B:22-280 |
| A0A125YN40 | DB00114 | PLP | 7nl1 | e7nl1C1 | C:19-280 |
| A0A125YN40 | DB00114 | PLP | 7nl1 | e7nl1C2 | C:281-417 |
| A0A125YN40 | DB00114 | PLP | 7nl1 | e7nl1D1 | D:18-280 |
| A0A125YN40 | DB00114 | PLP | 7nl1 | e7nl1D2 | D:281-417 |
| A0A125YN40 | DB00114 | PLP | 7nl1 | e7nl1E1 | E:21-280 |
| A0A125YN40 | DB00114 | PLP | 7nl1 | e7nl1E2 | E:281-417 |
| A0A125YN40 | DB00114 | PLP | 7nl1 | e7nl1F1 | F:21-280 |
| A0A125YN40 | DB00114 | PLP | 7nl1 | e7nl1F2 | F:281-417 |
| A0A125YN40 | DB00114 | PLP | 7nl1 | e7nl1G1 | G:21-280 |
| A0A125YN40 | DB00114 | PLP | 7nl1 | e7nl1G2 | G:281-417 |
| A0A125YN40 | DB00114 | PLP | 7nl1 | e7nl1H1 | H:281-417 |
| A0A125YN40 | DB00114 | PLP | 7nl1 | e7nl1H2 | H:19-280 |