Attributes
UniProt ID
Protein Name
Taste receptor, type 1, member 2a
Ligand Name
2-acetamido-2-deoxy-beta-D-glucopyranose
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
OVRNDRQMDRJTHS-FMDGEEDCSA-N
SMILES
CC(=O)NC1C(C(C(OC1O)CO)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 5X2M
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse5x2mA1e5x2mA2e5x2mB1e5x2mB2e5x2mC1e5x2mC2e5x2mD1e5x2mD2e5x2mH1e5x2mH2e5x2mJ1e5x2mJ2e5x2mK1e5x2mK2e5x2mL1e5x2mL2
ECOD domains from experimental PDB structures interacting with ligand DB00141
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| A0A173M0G2 | DB00141 | NAG | 5x2m | e5x2mA2 | A:182-466 |
| A0A173M0G2 | DB00141 | NAG | 5x2m | e5x2mC1 | C:182-465 |
| A0A173M0G2 | DB00141 | NAG | 5x2m | e5x2mC2 | C:25-182 |
| A0A173M0G2 | DB00141 | NAG | 5x2n | e5x2nA1 | A:182-465 |
| A0A173M0G2 | DB00141 | NAG | 5x2n | e5x2nC1 | C:182-465 |
| A0A173M0G2 | DB00141 | NAG | 5x2o | e5x2oA1 | A:25-182 |
| A0A173M0G2 | DB00141 | NAG | 5x2o | e5x2oA2 | A:182-466 |
| A0A173M0G2 | DB00141 | NAG | 5x2o | e5x2oC2 | C:182-465 |
| A0A173M0G2 | DB00141 | NAG | 5x2p | e5x2pA1 | A:182-466 |
| A0A173M0G2 | DB00141 | NAG | 5x2p | e5x2pA2 | A:25-182 |
| A0A173M0G2 | DB00141 | NAG | 5x2p | e5x2pC1 | C:25-182 |
| A0A173M0G2 | DB00141 | NAG | 5x2p | e5x2pC2 | C:182-465 |
| A0A173M0G2 | DB00141 | NAG | 5x2q | e5x2qA1 | A:182-466 |
| A0A173M0G2 | DB00141 | NAG | 5x2q | e5x2qA2 | A:26-182 |
| A0A173M0G2 | DB00141 | NAG | 5x2q | e5x2qC1 | C:182-465 |
| A0A173M0G2 | DB00141 | NAG | 5x2q | e5x2qC2 | C:25-182 |