Attributes
UniProt ID
Protein Name
deleted
Ligand Name
ADENOSINE-5'-DIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
XTWYTFMLZFPYCI-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 6PO1
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse6po1A1e6po1A2e6po1B1e6po1B2e6po1C1e6po1C2e6po1D1e6po1D2e6po1E1e6po1E2e6po1F1e6po1F2e6po1H1e6po1I1e6po1J1e6po1K1e6po1L1e6po1M1e6po1N1
ECOD domains from experimental PDB structures interacting with ligand DB16833
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| A0A1Q9L861 | DB16833 | ADP | 6po1 | e6po1F1 | F:64-316 |
| A0A1Q9L861 | DB16833 | ADP | 6po1 | e6po1F2 | F:317-413 |
| A0A1Q9L861 | DB16833 | ADP | 6po3 | e6po3F1 | F:317-413 |
| A0A1Q9L861 | DB16833 | ADP | 6po3 | e6po3F2 | F:64-316 |
| A0A1Q9L861 | DB16833 | ADP | 6pod | e6podA1 | A:64-316 |
| A0A1Q9L861 | DB16833 | ADP | 6pod | e6podA2 | A:317-413 |
| A0A1Q9L861 | DB16833 | ADP | 6pod | e6podB2 | B:63-316 |
| A0A1Q9L861 | DB16833 | ADP | 6pos | e6posF1 | F:317-413 |
| A0A1Q9L861 | DB16833 | ADP | 6pos | e6posF2 | F:64-316 |
| A0A1Q9L861 | DB16833 | ADP | 6pp5 | e6pp5F1 | F:317-413 |
| A0A1Q9L861 | DB16833 | ADP | 6pp5 | e6pp5F2 | F:64-316 |
| A0A1Q9L861 | DB16833 | ADP | 6pp6 | e6pp6F1 | F:317-413 |
| A0A1Q9L861 | DB16833 | ADP | 6pp6 | e6pp6F2 | F:64-316 |
| A0A1Q9L861 | DB16833 | ADP | 6pp7 | e6pp7A1 | A:317-413 |
| A0A1Q9L861 | DB16833 | ADP | 6pp7 | e6pp7A2 | A:64-316 |
| A0A1Q9L861 | DB16833 | ADP | 6pp7 | e6pp7B2 | B:63-316 |
| A0A1Q9L861 | DB16833 | ADP | 6pp8 | e6pp8F1 | F:317-413 |
| A0A1Q9L861 | DB16833 | ADP | 6pp8 | e6pp8F2 | F:64-316 |