Attributes
UniProt ID
Protein Name
Light-harvesting protein
Ligand Name
BACTERIOCHLOROPHYLL A
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
DSJXIQQMORJERS-AGGZHOMASA-M
SMILES
CCC1C(C2=CC3=C(C(=C4[N-]3[Mg+2]56[N]2=C1C=C7[N-]5C8=C(C(C(=O)C8=C7C)C(=O)OC)C9=[N]6C(=C4)C(C9CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)C)C)C(=O)C)C
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 7ZDI
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse7zdiA1e7zdiB1e7zdiC1e7zdiD1e7zdiE1e7zdiF1e7zdiG1e7zdiH1e7zdiI1e7zdiJ1e7zdiK1e7zdiL1e7zdiM1e7zdiN1e7zdiO1e7zdiP1e7zdiQ1e7zdiR1
ECOD domains from experimental PDB structures interacting with ligand DB01853
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| A0A2R4GZC1 | DB01853 | BCL | 7zdi | e7zdiB1 | B:3-51 |
| A0A2R4GZC1 | DB01853 | BCL | 7zdi | e7zdiD1 | D:3-51 |
| A0A2R4GZC1 | DB01853 | BCL | 7zdi | e7zdiF1 | F:3-51 |
| A0A2R4GZC1 | DB01853 | BCL | 7zdi | e7zdiH1 | H:3-51 |
| A0A2R4GZC1 | DB01853 | BCL | 7zdi | e7zdiJ1 | J:3-51 |
| A0A2R4GZC1 | DB01853 | BCL | 7zdi | e7zdiL1 | L:3-51 |
| A0A2R4GZC1 | DB01853 | BCL | 7zdi | e7zdiN1 | N:3-51 |
| A0A2R4GZC1 | DB01853 | BCL | 7zdi | e7zdiP1 | P:3-51 |
| A0A2R4GZC1 | DB01853 | BCL | 7zdi | e7zdiR1 | R:3-51 |
| A0A2R4GZC1 | DB01853 | BCL | 7ze8 | e7ze8B1 | B:2-47 |
| A0A2R4GZC1 | DB01853 | BCL | 7ze8 | e7ze8D1 | D:2-47 |
| A0A2R4GZC1 | DB01853 | BCL | 7ze8 | e7ze8F1 | F:2-47 |
| A0A2R4GZC1 | DB01853 | BCL | 7ze8 | e7ze8H1 | H:2-47 |
| A0A2R4GZC1 | DB01853 | BCL | 7ze8 | e7ze8J1 | J:2-47 |
| A0A2R4GZC1 | DB01853 | BCL | 7ze8 | e7ze8L1 | L:2-47 |
| A0A2R4GZC1 | DB01853 | BCL | 7ze8 | e7ze8N1 | N:2-47 |
| A0A2R4GZC1 | DB01853 | BCL | 7ze8 | e7ze8P1 | P:2-47 |
| A0A2R4GZC1 | DB01853 | BCL | 7ze8 | e7ze8R1 | R:2-47 |