Attributes
UniProt ID
Protein Name
G protein-activated inward rectifier potassium channel 2
Ligand Name
[(2R)-2-octanoyloxy-3-[oxidanyl-[(1R,2R,3S,4R,5R,6S)-2,3,6-tris(oxidanyl)-4,5-diphosphonooxy-cyclohexyl]oxy-phosphoryl]oxy-propyl] octanoate
DrugBank ID
None
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
XLNCEHRXXWQMPK-MJUMVPIBSA-N
SMILES
CCCCCCCC(=O)OCC(COP(=O)(O)OC1C(C(C(C(C1O)OP(=O)(O)O)OP(=O)(O)O)O)O)OC(=O)CCCCCCC
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 6XEU
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse6xeuA1e6xeuA2e6xeuD1e6xeuD2e6xeuG1e6xeuG2e6xeuJ1e6xeuJ2
ECOD domains from experimental PDB structures interacting with ligand PIO
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| A0A338P6L0 | n/a | PIO | 6xeu | e6xeuA1 | A:198-382 |
| A0A338P6L0 | n/a | PIO | 6xeu | e6xeuA2 | A:55-199 |
| A0A338P6L0 | n/a | PIO | 6xeu | e6xeuD1 | D:198-382 |
| A0A338P6L0 | n/a | PIO | 6xeu | e6xeuD2 | D:55-199 |
| A0A338P6L0 | n/a | PIO | 6xeu | e6xeuG1 | G:198-382 |
| A0A338P6L0 | n/a | PIO | 6xeu | e6xeuG2 | G:55-199 |
| A0A338P6L0 | n/a | PIO | 6xeu | e6xeuJ1 | J:198-382 |
| A0A338P6L0 | n/a | PIO | 6xeu | e6xeuJ2 | J:55-199 |
| A0A338P6L0 | n/a | PIO | 6xev | e6xevA1 | A:198-382 |
| A0A338P6L0 | n/a | PIO | 6xev | e6xevA2 | A:55-199 |
| A0A338P6L0 | n/a | PIO | 6xev | e6xevE1 | E:198-382 |
| A0A338P6L0 | n/a | PIO | 6xev | e6xevE2 | E:55-199 |
| A0A338P6L0 | n/a | PIO | 6xev | e6xevI1 | I:198-382 |
| A0A338P6L0 | n/a | PIO | 6xev | e6xevI2 | I:55-199 |
| A0A338P6L0 | n/a | PIO | 6xev | e6xevM1 | M:198-382 |
| A0A338P6L0 | n/a | PIO | 6xev | e6xevM2 | M:55-199 |
| A0A338P6L0 | n/a | PIO | 6xit | e6xitA1 | A:200-381 |
| A0A338P6L0 | n/a | PIO | 6xit | e6xitA2 | A:55-199 |
| A0A338P6L0 | n/a | PIO | 6xit | e6xitB1 | B:200-381 |
| A0A338P6L0 | n/a | PIO | 6xit | e6xitB2 | B:55-199 |
| A0A338P6L0 | n/a | PIO | 6xit | e6xitC1 | C:55-199 |
| A0A338P6L0 | n/a | PIO | 6xit | e6xitC2 | C:200-381 |
| A0A338P6L0 | n/a | PIO | 6xit | e6xitD1 | D:55-199 |
| A0A338P6L0 | n/a | PIO | 6xit | e6xitD2 | D:200-381 |