Attributes
UniProt ID
Protein Name
Ribulose bisphosphate carboxylase large chain
Ligand Name
2-CARBOXYARABINITOL-1,5-DIPHOSPHATE
DrugBank ID
None
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
ITHCSGCUQDMYAI-ZMIZWQJLSA-N
SMILES
C(C(C(C(COP(=O)(O)O)(C(=O)O)O)O)O)OP(=O)(O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 5N9Z
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse5n9zA1e5n9zA2e5n9zB1e5n9zB2e5n9zC1e5n9zC2e5n9zD1e5n9zD2e5n9zE1e5n9zE2e5n9zF1e5n9zF2e5n9zG1e5n9zG2e5n9zH1e5n9zH2e5n9zI1e5n9zJ1e5n9zK1e5n9zL1e5n9zM1e5n9zN1e5n9zO1e5n9zP1
ECOD domains from experimental PDB structures interacting with ligand CAP
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| A0A384E0M2 | n/a | CAP | 5n9z | e5n9zA1 | A:4-153 |
| A0A384E0M2 | n/a | CAP | 5n9z | e5n9zA2 | A:154-484 |
| A0A384E0M2 | n/a | CAP | 5n9z | e5n9zB1 | B:4-153 |
| A0A384E0M2 | n/a | CAP | 5n9z | e5n9zB2 | B:154-484 |
| A0A384E0M2 | n/a | CAP | 5n9z | e5n9zC1 | C:154-484 |
| A0A384E0M2 | n/a | CAP | 5n9z | e5n9zC2 | C:4-153 |
| A0A384E0M2 | n/a | CAP | 5n9z | e5n9zD1 | D:4-153 |
| A0A384E0M2 | n/a | CAP | 5n9z | e5n9zD2 | D:154-484 |
| A0A384E0M2 | n/a | CAP | 5n9z | e5n9zE1 | E:154-484 |
| A0A384E0M2 | n/a | CAP | 5n9z | e5n9zE2 | E:4-153 |
| A0A384E0M2 | n/a | CAP | 5n9z | e5n9zF1 | F:154-484 |
| A0A384E0M2 | n/a | CAP | 5n9z | e5n9zF2 | F:4-153 |
| A0A384E0M2 | n/a | CAP | 5n9z | e5n9zG1 | G:4-153 |
| A0A384E0M2 | n/a | CAP | 5n9z | e5n9zG2 | G:154-484 |
| A0A384E0M2 | n/a | CAP | 5n9z | e5n9zH1 | H:154-484 |
| A0A384E0M2 | n/a | CAP | 5n9z | e5n9zH2 | H:4-153 |