Attributes
UniProt ID
Protein Name
UDP-N-acetylglucosamine 1-carboxyvinyltransferase
Ligand Name
(2R)-2-{[(2R,3R,4R,5S,6R)-3-(acetylamino)-2-{[(S)-{[(R)-{[(2R,3S,4R,5R)-5-(2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl)-3,4-dihydroxytetrahydrofuran-2-yl]methoxy}(hydroxy)phosphoryl]oxy}(hydroxy)phosphoryl]oxy}-5-hydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-4-yl]oxy}propanoic acid
DrugBank ID
None
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
NQBRVZNDBBMBLJ-MQTLHLSBSA-N
SMILES
CC(C(=O)O)OC1C(C(OC(C1O)CO)OP(=O)(O)OP(=O)(O)OCC2C(C(C(O2)N3C=CC(=O)NC3=O)O)O)NC(=O)C
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 8D84
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse8d84A1e8d84A2e8d84B1e8d84B2e8d84C1e8d84C2e8d84D1e8d84D2e8d84E1e8d84E2e8d84F1e8d84F2e8d84G1e8d84G2e8d84H1e8d84H2e8d84I1e8d84I2e8d84J1e8d84J2e8d84K1e8d84K2e8d84L1e8d84L2
ECOD domains from experimental PDB structures interacting with ligand EPZ
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| A0A3N3SEJ7 | n/a | EPZ | 8d84 | e8d84A1 | A:1-20,A:233-420 |
| A0A3N3SEJ7 | n/a | EPZ | 8d84 | e8d84A2 | A:21-232 |
| A0A3N3SEJ7 | n/a | EPZ | 8d84 | e8d84B1 | B:1-20,B:233-420 |
| A0A3N3SEJ7 | n/a | EPZ | 8d84 | e8d84B2 | B:21-232 |
| A0A3N3SEJ7 | n/a | EPZ | 8d84 | e8d84C1 | C:1-20,C:233-420 |
| A0A3N3SEJ7 | n/a | EPZ | 8d84 | e8d84C2 | C:21-232 |
| A0A3N3SEJ7 | n/a | EPZ | 8d84 | e8d84D1 | D:21-232 |
| A0A3N3SEJ7 | n/a | EPZ | 8d84 | e8d84D2 | D:1-20,D:233-420 |
| A0A3N3SEJ7 | n/a | EPZ | 8d84 | e8d84E1 | E:21-232 |
| A0A3N3SEJ7 | n/a | EPZ | 8d84 | e8d84E2 | E:1-20,E:233-420 |
| A0A3N3SEJ7 | n/a | EPZ | 8d84 | e8d84F1 | F:21-232 |
| A0A3N3SEJ7 | n/a | EPZ | 8d84 | e8d84F2 | F:1-20,F:233-420 |
| A0A3N3SEJ7 | n/a | EPZ | 8d84 | e8d84G1 | G:21-232 |
| A0A3N3SEJ7 | n/a | EPZ | 8d84 | e8d84G2 | G:1-20,G:233-420 |
| A0A3N3SEJ7 | n/a | EPZ | 8d84 | e8d84H1 | H:21-232 |
| A0A3N3SEJ7 | n/a | EPZ | 8d84 | e8d84H2 | H:1-20,H:233-420 |
| A0A3N3SEJ7 | n/a | EPZ | 8d84 | e8d84I1 | I:21-232 |
| A0A3N3SEJ7 | n/a | EPZ | 8d84 | e8d84I2 | I:1-20,I:233-420 |
| A0A3N3SEJ7 | n/a | EPZ | 8d84 | e8d84J1 | J:1-20,J:233-420 |
| A0A3N3SEJ7 | n/a | EPZ | 8d84 | e8d84J2 | J:21-232 |
| A0A3N3SEJ7 | n/a | EPZ | 8d84 | e8d84K1 | K:21-232 |
| A0A3N3SEJ7 | n/a | EPZ | 8d84 | e8d84K2 | K:1-20,K:233-420 |
| A0A3N3SEJ7 | n/a | EPZ | 8d84 | e8d84L1 | L:21-232 |
| A0A3N3SEJ7 | n/a | EPZ | 8d84 | e8d84L2 | L:1-20,L:233-420 |