Attributes
UniProt ID
Protein Name
Carbonic anhydrase
Ligand Name
2-acetamido-2-deoxy-beta-D-glucopyranose
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
OVRNDRQMDRJTHS-FMDGEEDCSA-N
SMILES
CC(=O)NC1C(C(C(OC1O)CO)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 7BM4
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse7bm4A1e7bm4B1
ECOD domains from experimental PDB structures interacting with ligand DB00141
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| A0A3Q0KSG2 | DB00141 | NAG | 7bm4 | e7bm4A1 | A:24-299 |
| A0A3Q0KSG2 | DB00141 | NAG | 7bm4 | e7bm4B1 | B:24-299 |
| A0A3Q0KSG2 | DB00141 | NAG | 7nex | e7nexA1 | A:24-300 |
| A0A3Q0KSG2 | DB00141 | NAG | 7nex | e7nexB1 | B:24-300 |
| A0A3Q0KSG2 | DB00141 | NAG | 7ng1 | e7ng1A1 | A:24-300 |
| A0A3Q0KSG2 | DB00141 | NAG | 7ng1 | e7ng1B1 | B:24-300 |
| A0A3Q0KSG2 | DB00141 | NAG | 7nwy | e7nwyAAA1 | AAA:24-300 |
| A0A3Q0KSG2 | DB00141 | NAG | 7nwy | e7nwyBBB1 | BBB:24-300 |
| A0A3Q0KSG2 | DB00141 | NAG | 7o2s | e7o2sA1 | A:24-299 |
| A0A3Q0KSG2 | DB00141 | NAG | 7o48 | e7o48A1 | A:24-301 |
| A0A3Q0KSG2 | DB00141 | NAG | 7o48 | e7o48B1 | B:23-301 |
| A0A3Q0KSG2 | DB00141 | NAG | 7oa1 | e7oa1AAA1 | AAA:24-300 |
| A0A3Q0KSG2 | DB00141 | NAG | 7oa1 | e7oa1BBB1 | BBB:24-300 |
| A0A3Q0KSG2 | DB00141 | NAG | 7pri | e7priAAA1 | AAA:24-300 |
| A0A3Q0KSG2 | DB00141 | NAG | 7pri | e7priBBB1 | BBB:24-300 |
| A0A3Q0KSG2 | DB00141 | NAG | 7yzh | e7yzhAAA1 | AAA:24-300 |
| A0A3Q0KSG2 | DB00141 | NAG | 7yzh | e7yzhBBB1 | BBB:24-299 |