Attributes
UniProt ID
Protein Name
propionyl-CoA carboxylase
Ligand Name
5-(HEXAHYDRO-2-OXO-1H-THIENO[3,4-D]IMIDAZOL-6-YL)PENTANAL
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
ARDNWGMSCXSPBF-CIUDSAMLSA-N
SMILES
C1C2C(C(S1)CCCCC=O)NC(=O)N2
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 8SGX
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse8sgxC1e8sgxC2e8sgxD1e8sgxD2e8sgxE1e8sgxE2e8sgxF1e8sgxF2e8sgxG1e8sgxG2e8sgxH1e8sgxH2e8sgxS1e8sgxS2e8sgxS3e8sgxS4e8sgxS5e8sgxV1e8sgxV2e8sgxV3e8sgxV4e8sgxV5e8sgxX1e8sgxX2e8sgxX3e8sgxX4e8sgxX5e8sgxZ1e8sgxZ2e8sgxZ3e8sgxZ4e8sgxZ5
ECOD domains from experimental PDB structures interacting with ligand DB07497
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| A0A640KC69 | DB07497 | BTI | 8sgx | e8sgxS4 | S:592-665 |
| A0A640KC69 | DB07497 | BTI | 8sgx | e8sgxV4 | V:592-665 |
| A0A640KC69 | DB07497 | BTI | 8sgx | e8sgxX4 | X:592-665 |
| A0A640KC69 | DB07497 | BTI | 8sgx | e8sgxZ3 | Z:592-665 |
| A0A640KC69 | DB07497 | BTI | 8sgy | e8sgyB2 | B:592-665 |
| A0A640KC69 | DB07497 | BTI | 8sgy | e8sgyS5 | S:592-665 |
| A0A640KC69 | DB07497 | BTI | 8sgy | e8sgyV1 | V:592-665 |
| A0A640KC69 | DB07497 | BTI | 8sgy | e8sgyY1 | Y:592-665 |
| A0A640KC69 | DB07497 | BTI | 8sgy | e8sgyY3 | Y:335-456 |
| A0A640KC69 | DB07497 | BTI | 8sgy | e8sgyZ5 | Z:592-665 |
| A0A640KC69 | DB07497 | BTI | 8sgz | e8sgzB5 | B:592-665 |
| A0A640KC69 | DB07497 | BTI | 8sgz | e8sgzS2 | S:592-665 |
| A0A640KC69 | DB07497 | BTI | 8sgz | e8sgzV3 | V:592-665 |
| A0A640KC69 | DB07497 | BTI | 8sgz | e8sgzX1 | X:592-665 |
| A0A640KC69 | DB07497 | BTI | 8sgz | e8sgzY1 | Y:592-665 |
| A0A640KC69 | DB07497 | BTI | 8sgz | e8sgzY5 | Y:335-456 |
| A0A640KC69 | DB07497 | BTI | 8sgz | e8sgzZ1 | Z:592-665 |