Attributes
UniProt ID
Protein Name
deleted
Ligand Name
GUANOSINE-5'-TRIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
XKMLYUALXHKNFT-UUOKFMHZSA-N
SMILES
c1nc2c(n1C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O)N=C(NC2=O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 7X55
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse7x55A1e7x55A2e7x55B1e7x55B2e7x55C1e7x55C2e7x55D1e7x55D2e7x55E1e7x55E2
ECOD domains from experimental PDB structures interacting with ligand DB04137
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| A0A6B3ZKE5 | DB04137 | GTP | 7x55 | e7x55A1 | A:1-144 |
| A0A6B3ZKE5 | DB04137 | GTP | 7x55 | e7x55A2 | A:145-285 |
| A0A6B3ZKE5 | DB04137 | GTP | 7x55 | e7x55B1 | B:1-144 |
| A0A6B3ZKE5 | DB04137 | GTP | 7x55 | e7x55B2 | B:145-285 |
| A0A6B3ZKE5 | DB04137 | GTP | 7x55 | e7x55C1 | C:1-144 |
| A0A6B3ZKE5 | DB04137 | GTP | 7x55 | e7x55C2 | C:145-285 |
| A0A6B3ZKE5 | DB04137 | GTP | 7x55 | e7x55D1 | D:1-144 |
| A0A6B3ZKE5 | DB04137 | GTP | 7x55 | e7x55D2 | D:145-285 |
| A0A6B3ZKE5 | DB04137 | GTP | 7x55 | e7x55E1 | E:1-144 |
| A0A6B3ZKE5 | DB04137 | GTP | 7x55 | e7x55E2 | E:145-285 |
| A0A6B3ZKE5 | DB04137 | GTP | 7x59 | e7x59A1 | A:1-144 |
| A0A6B3ZKE5 | DB04137 | GTP | 7x59 | e7x59A2 | A:145-285 |
| A0A6B3ZKE5 | DB04137 | GTP | 7x59 | e7x59B1 | B:1-144 |
| A0A6B3ZKE5 | DB04137 | GTP | 7x59 | e7x59B2 | B:145-285 |
| A0A6B3ZKE5 | DB04137 | GTP | 7x59 | e7x59C1 | C:1-144 |
| A0A6B3ZKE5 | DB04137 | GTP | 7x59 | e7x59C2 | C:145-285 |
| A0A6B3ZKE5 | DB04137 | GTP | 7x59 | e7x59D1 | D:1-144 |
| A0A6B3ZKE5 | DB04137 | GTP | 7x59 | e7x59D2 | D:145-285 |
| A0A6B3ZKE5 | DB04137 | GTP | 7x59 | e7x59E1 | E:1-144 |
| A0A6B3ZKE5 | DB04137 | GTP | 7x59 | e7x59E2 | E:145-285 |