Attributes
UniProt ID
Protein Name
Methyltransferase
Ligand Name
S-ADENOSYL-L-HOMOCYSTEINE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
ZJUKTBDSGOFHSH-WFMPWKQPSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)CSCCC(C(=O)O)N)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 8BIG
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse8bigA1e8bigA2e8bigB1e8bigB2e8bigC1e8bigC2e8bigD1e8bigD2e8bigE1e8bigE2e8bigF1e8bigF2e8bigG1e8bigG2e8bigH1e8bigH2
ECOD domains from experimental PDB structures interacting with ligand DB01752
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| A0A6L9JQS9 | DB01752 | SAH | 8big | e8bigA1 | A:79-317 |
| A0A6L9JQS9 | DB01752 | SAH | 8big | e8bigB2 | B:79-317 |
| A0A6L9JQS9 | DB01752 | SAH | 8big | e8bigC2 | C:79-317 |
| A0A6L9JQS9 | DB01752 | SAH | 8big | e8bigD2 | D:79-317 |
| A0A6L9JQS9 | DB01752 | SAH | 8big | e8bigE2 | E:79-317 |
| A0A6L9JQS9 | DB01752 | SAH | 8big | e8bigF2 | F:79-317 |
| A0A6L9JQS9 | DB01752 | SAH | 8big | e8bigG1 | G:79-317 |
| A0A6L9JQS9 | DB01752 | SAH | 8big | e8bigH1 | H:79-317 |
| A0A6L9JQS9 | DB01752 | SAH | 8bii | e8biiA1 | A:79-317 |
| A0A6L9JQS9 | DB01752 | SAH | 8bii | e8biiB1 | B:79-317 |
| A0A6L9JQS9 | DB01752 | SAH | 8bii | e8biiC2 | C:79-317 |
| A0A6L9JQS9 | DB01752 | SAH | 8bii | e8biiD2 | D:79-317 |
| A0A6L9JQS9 | DB01752 | SAH | 8bii | e8biiE2 | E:79-317 |
| A0A6L9JQS9 | DB01752 | SAH | 8bii | e8biiF1 | F:79-317 |
| A0A6L9JQS9 | DB01752 | SAH | 8bii | e8biiG1 | G:79-317 |
| A0A6L9JQS9 | DB01752 | SAH | 8bii | e8biiH1 | H:79-316 |
| A0A6L9JQS9 | DB01752 | SAH | 8bir | e8birA1 | A:79-317 |
| A0A6L9JQS9 | DB01752 | SAH | 8bir | e8birB2 | B:79-317 |