Attributes
UniProt ID
Protein Name
FAD-binding oxidoreductase
Ligand Name
FLAVIN-ADENINE DINUCLEOTIDE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
VWWQXMAJTJZDQX-UYBVJOGSSA-N
SMILES
Cc1cc2c(cc1C)N(C3=NC(=O)NC(=O)C3=N2)CC(C(C(COP(=O)(O)OP(=O)(O)OCC4C(C(C(O4)n5cnc6c5ncnc6N)O)O)O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 7PBG
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse7pbgA1e7pbgA2e7pbgB1e7pbgB2
ECOD domains from experimental PDB structures interacting with ligand DB03147
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| A0A7J5BGR1 | DB03147 | FAD | 7pbg | e7pbgA1 | A:3-239 |
| A0A7J5BGR1 | DB03147 | FAD | 7pbg | e7pbgA2 | A:240-527 |
| A0A7J5BGR1 | DB03147 | FAD | 7pbg | e7pbgB1 | B:3-239 |
| A0A7J5BGR1 | DB03147 | FAD | 7pbg | e7pbgB2 | B:240-527 |
| A0A7J5BGR1 | DB03147 | FAD | 7pbi | e7pbiA1 | A:5-239 |
| A0A7J5BGR1 | DB03147 | FAD | 7pbi | e7pbiA2 | A:240-527 |
| A0A7J5BGR1 | DB03147 | FAD | 7pbi | e7pbiB1 | B:3-239 |
| A0A7J5BGR1 | DB03147 | FAD | 7pbi | e7pbiB2 | B:240-527 |
| A0A7J5BGR1 | DB03147 | FAD | 7pbi | e7pbiC1 | C:5-239 |
| A0A7J5BGR1 | DB03147 | FAD | 7pbi | e7pbiC2 | C:240-527 |
| A0A7J5BGR1 | DB03147 | FAD | 7pbi | e7pbiD1 | D:3-239 |
| A0A7J5BGR1 | DB03147 | FAD | 7pbi | e7pbiD2 | D:240-527 |
| A0A7J5BGR1 | DB03147 | FAD | 7pbi | e7pbiE1 | E:5-239 |
| A0A7J5BGR1 | DB03147 | FAD | 7pbi | e7pbiE2 | E:240-527 |
| A0A7J5BGR1 | DB03147 | FAD | 7pbi | e7pbiF1 | F:3-239 |
| A0A7J5BGR1 | DB03147 | FAD | 7pbi | e7pbiF2 | F:240-527 |
| A0A7J5BGR1 | DB03147 | FAD | 7pbi | e7pbiG1 | G:5-239 |
| A0A7J5BGR1 | DB03147 | FAD | 7pbi | e7pbiG2 | G:240-527 |
| A0A7J5BGR1 | DB03147 | FAD | 7pbi | e7pbiH1 | H:3-239 |
| A0A7J5BGR1 | DB03147 | FAD | 7pbi | e7pbiH2 | H:240-527 |