Attributes
UniProt ID
Protein Name
ATP synthase subunit alpha
Ligand Name
ADENOSINE-5'-DIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
XTWYTFMLZFPYCI-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 6RDB
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse6rdbA1e6rdbB1e6rdbC1e6rdbD1e6rdbE1e6rdbF1e6rdbG1e6rdbH1e6rdbI1e6rdbJ1e6rdbP1e6rdbQ1e6rdbS1e6rdbT1e6rdbT2e6rdbT3e6rdbX1e6rdbX2e6rdbZ1e6rdbZ2
ECOD domains from experimental PDB structures interacting with ligand DB16833
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| A0ZW40 | DB16833 | ADP | 6rdb | e6rdbT2 | T:151-435 |
| A0ZW40 | DB16833 | ADP | 6rde | e6rdeT3 | T:151-435 |
| A0ZW40 | DB16833 | ADP | 6rdj | e6rdjT1 | T:151-435 |
| A0ZW40 | DB16833 | ADP | 6rdm | e6rdmT2 | T:151-435 |
| A0ZW40 | DB16833 | ADP | 6rdm | e6rdmT3 | T:436-562 |
| A0ZW40 | DB16833 | ADP | 6rdp | e6rdpT2 | T:151-435 |
| A0ZW40 | DB16833 | ADP | 6rdp | e6rdpT3 | T:436-562 |
| A0ZW40 | DB16833 | ADP | 6rds | e6rdsT2 | T:151-435 |
| A0ZW40 | DB16833 | ADP | 6rds | e6rdsT3 | T:436-562 |
| A0ZW40 | DB16833 | ADP | 6rdv | e6rdvT1 | T:436-562 |
| A0ZW40 | DB16833 | ADP | 6rdv | e6rdvT3 | T:151-435 |
| A0ZW40 | DB16833 | ADP | 6rdy | e6rdyT3 | T:151-435 |
| A0ZW40 | DB16833 | ADP | 6re1 | e6re1T2 | T:436-562 |
| A0ZW40 | DB16833 | ADP | 6re1 | e6re1T3 | T:151-435 |
| A0ZW40 | DB16833 | ADP | 6re4 | e6re4T3 | T:151-435 |
| A0ZW40 | DB16833 | ADP | 6re7 | e6re7T3 | T:151-435 |
| A0ZW40 | DB16833 | ADP | 6rea | e6reaT2 | T:151-435 |