Attributes
UniProt ID
Protein Name
3-amino-2-methylpropionate transaminase
Ligand Name
PYRIDOXAL-5'-PHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
NGVDGCNFYWLIFO-UHFFFAOYSA-N
SMILES
Cc1c(c(c(cn1)COP(=O)(O)O)C=O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 4ATP
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse4atpA2e4atpA3e4atpB2e4atpB3e4atpC2e4atpC3e4atpD2e4atpD3e4atpE2e4atpE3e4atpF1e4atpF2e4atpG2e4atpG3e4atpH2e4atpH3e4atpI2e4atpI3e4atpJ2e4atpJ3e4atpK1e4atpK2e4atpL2e4atpL3
ECOD domains from experimental PDB structures interacting with ligand DB00114
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| A1R958 | DB00114 | PLP | 4atp | e4atpA2 | A:9-347 |
| A1R958 | DB00114 | PLP | 4atp | e4atpB2 | B:8-348 |
| A1R958 | DB00114 | PLP | 4atp | e4atpC2 | C:9-347 |
| A1R958 | DB00114 | PLP | 4atp | e4atpD2 | D:9-347 |
| A1R958 | DB00114 | PLP | 4atp | e4atpE2 | E:8-348 |
| A1R958 | DB00114 | PLP | 4atp | e4atpF1 | F:9-348 |
| A1R958 | DB00114 | PLP | 4atp | e4atpG2 | G:9-347 |
| A1R958 | DB00114 | PLP | 4atp | e4atpH2 | H:9-347 |
| A1R958 | DB00114 | PLP | 4atp | e4atpI2 | I:10-347 |
| A1R958 | DB00114 | PLP | 4atp | e4atpJ2 | J:10-348 |
| A1R958 | DB00114 | PLP | 4atp | e4atpK1 | K:9-348 |
| A1R958 | DB00114 | PLP | 4atp | e4atpL2 | L:11-348 |
| A1R958 | DB00114 | PLP | 4atq | e4atqA1 | A:9-348 |
| A1R958 | DB00114 | PLP | 4atq | e4atqB1 | B:8-348 |
| A1R958 | DB00114 | PLP | 4atq | e4atqC1 | C:9-348 |
| A1R958 | DB00114 | PLP | 4atq | e4atqD1 | D:9-348 |
| A1R958 | DB00114 | PLP | 4atq | e4atqE2 | E:7-348 |
| A1R958 | DB00114 | PLP | 4atq | e4atqF1 | F:8-348 |
| A1R958 | DB00114 | PLP | 4atq | e4atqG1 | G:9-348 |
| A1R958 | DB00114 | PLP | 4atq | e4atqH1 | H:9-348 |
| A1R958 | DB00114 | PLP | 4atq | e4atqI1 | I:9-348 |
| A1R958 | DB00114 | PLP | 4atq | e4atqJ2 | J:10-348 |
| A1R958 | DB00114 | PLP | 4atq | e4atqK1 | K:10-348 |
| A1R958 | DB00114 | PLP | 4atq | e4atqL1 | L:11-348 |