Attributes
UniProt ID
Protein Name
ABC-type bacteriocin transporter
Ligand Name
ADENOSINE-5'-TRIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
ZKHQWZAMYRWXGA-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 7T54
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse7t54A1e7t54A2e7t54A3e7t54B1e7t54B2e7t54B3
ECOD domains from experimental PDB structures interacting with ligand DB00171
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| A3DCU1 | DB00171 | ATP | 7t54 | e7t54A1 | A:468-722 |
| A3DCU1 | DB00171 | ATP | 7t54 | e7t54A2 | A:152-467 |
| A3DCU1 | DB00171 | ATP | 7t54 | e7t54B1 | B:468-722 |
| A3DCU1 | DB00171 | ATP | 7t54 | e7t54B3 | B:153-467 |
| A3DCU1 | DB00171 | ATP | 7t55 | e7t55A1 | A:468-722 |
| A3DCU1 | DB00171 | ATP | 7t55 | e7t55A3 | A:153-467 |
| A3DCU1 | DB00171 | ATP | 7t55 | e7t55B2 | B:468-722 |
| A3DCU1 | DB00171 | ATP | 7t55 | e7t55B3 | B:153-467 |
| A3DCU1 | DB00171 | ATP | 7t56 | e7t56A1 | A:152-468 |
| A3DCU1 | DB00171 | ATP | 7t56 | e7t56A2 | A:469-722 |
| A3DCU1 | DB00171 | ATP | 7t56 | e7t56B2 | B:468-722 |
| A3DCU1 | DB00171 | ATP | 7t56 | e7t56B3 | B:153-467 |
| A3DCU1 | DB00171 | ATP | 7t57 | e7t57A3 | A:469-722 |
| A3DCU1 | DB00171 | ATP | 7t57 | e7t57B1 | B:8-152 |
| A3DCU1 | DB00171 | ATP | 7t57 | e7t57B3 | B:469-722 |