Attributes
UniProt ID
Protein Name
Hemagglutinin
Ligand Name
2-acetamido-2-deoxy-beta-D-glucopyranose
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
OVRNDRQMDRJTHS-FMDGEEDCSA-N
SMILES
CC(=O)NC1C(C(C(OC1O)CO)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 8TP2
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse8tp2A1e8tp2A2e8tp2B1e8tp2B2e8tp2C1e8tp2C2e8tp2H1e8tp2L1
ECOD domains from experimental PDB structures interacting with ligand DB00141
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| A3KF33 | DB00141 | NAG | 8tp2 | e8tp2A2 | A:11-330 |
| A3KF33 | DB00141 | NAG | 8tp2 | e8tp2B2 | B:11-330 |
| A3KF33 | DB00141 | NAG | 8tp2 | e8tp2C2 | C:11-330 |
| A3KF33 | DB00141 | NAG | 8tp4 | e8tp4A1 | A:324F-495 |
| A3KF33 | DB00141 | NAG | 8tp4 | e8tp4A2 | A:11-324F |
| A3KF33 | DB00141 | NAG | 8tp4 | e8tp4B1 | B:330-487 |
| A3KF33 | DB00141 | NAG | 8tp4 | e8tp4B2 | B:11-330 |
| A3KF33 | DB00141 | NAG | 8tp4 | e8tp4C1 | C:11-330 |
| A3KF33 | DB00141 | NAG | 8tp4 | e8tp4C2 | C:330-495 |
| A3KF33 | DB00141 | NAG | 8tp6 | e8tp6A1 | A:11-330 |
| A3KF33 | DB00141 | NAG | 8tp6 | e8tp6A2 | A:330-493 |
| A3KF33 | DB00141 | NAG | 8tp6 | e8tp6B1 | B:330-493 |
| A3KF33 | DB00141 | NAG | 8tp6 | e8tp6B2 | B:11-330 |
| A3KF33 | DB00141 | NAG | 8tp6 | e8tp6E1 | E:11-330 |
| A3KF33 | DB00141 | NAG | 8tp6 | e8tp6E2 | E:330-493 |
| A3KF33 | DB00141 | NAG | 8tp7 | e8tp7A1 | A:11-330 |
| A3KF33 | DB00141 | NAG | 8tp7 | e8tp7B2 | B:11-330 |
| A3KF33 | DB00141 | NAG | 8tp7 | e8tp7C2 | C:11-330 |
| A3KF33 | DB00141 | NAG | 8tp9 | e8tp9A2 | A:11-330 |
| A3KF33 | DB00141 | NAG | 8tp9 | e8tp9B2 | B:11-330 |
| A3KF33 | DB00141 | NAG | 8tp9 | e8tp9C2 | C:11-330 |