Attributes
UniProt ID
Protein Name
ATP synthase subunit alpha
Ligand Name
ADENOSINE-5'-TRIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
ZKHQWZAMYRWXGA-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 7P2Y
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse7p2yA1e7p2yA2e7p2yA3e7p2yB1e7p2yB2e7p2yB3e7p2yC1e7p2yC2e7p2yC3e7p2yD1e7p2yD2e7p2yD3e7p2yE1e7p2yE2e7p2yE3e7p2yF1e7p2yF2e7p2yF3e7p2yG1e7p2yH1e7p2yJ1e7p2yK1e7p2yL1e7p2yO1e7p2yP1e7p2yQ1e7p2yR1e7p2yS1e7p2ya1e7p2yb1e7p2yd1e7p2ye1e7p2ye2e7p2yg1e7p2yp1
ECOD domains from experimental PDB structures interacting with ligand DB00171
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| A3M142 | DB00171 | ATP | 7p2y | e7p2yA1 | A:384-511 |
| A3M142 | DB00171 | ATP | 7p2y | e7p2yA2 | A:96-383 |
| A3M142 | DB00171 | ATP | 7p2y | e7p2yB1 | B:96-383 |
| A3M142 | DB00171 | ATP | 7p2y | e7p2yB2 | B:384-514 |
| A3M142 | DB00171 | ATP | 7p2y | e7p2yC2 | C:384-514 |
| A3M142 | DB00171 | ATP | 7p2y | e7p2yC3 | C:96-383 |
| A3M142 | DB00171 | ATP | 7p3n | e7p3nA1 | A:96-383 |
| A3M142 | DB00171 | ATP | 7p3n | e7p3nA3 | A:384-514 |
| A3M142 | DB00171 | ATP | 7p3n | e7p3nB1 | B:384-514 |
| A3M142 | DB00171 | ATP | 7p3n | e7p3nB2 | B:96-383 |
| A3M142 | DB00171 | ATP | 7p3n | e7p3nC1 | C:96-383 |
| A3M142 | DB00171 | ATP | 7p3n | e7p3nC2 | C:384-511 |
| A3M142 | DB00171 | ATP | 7p3w | e7p3wA2 | A:384-514 |
| A3M142 | DB00171 | ATP | 7p3w | e7p3wA3 | A:96-383 |
| A3M142 | DB00171 | ATP | 7p3w | e7p3wB1 | B:384-511 |
| A3M142 | DB00171 | ATP | 7p3w | e7p3wB2 | B:96-383 |
| A3M142 | DB00171 | ATP | 7p3w | e7p3wC1 | C:384-514 |
| A3M142 | DB00171 | ATP | 7p3w | e7p3wC2 | C:96-383 |
| A3M142 | DB00171 | ATP | 7yry | e7yryA1 | A:96-383 |
| A3M142 | DB00171 | ATP | 7yry | e7yryA2 | A:384-514 |
| A3M142 | DB00171 | ATP | 7yry | e7yryB1 | B:96-383 |
| A3M142 | DB00171 | ATP | 7yry | e7yryB2 | B:384-514 |
| A3M142 | DB00171 | ATP | 7yry | e7yryC1 | C:96-383 |
| A3M142 | DB00171 | ATP | 7yry | e7yryC2 | C:384-514 |