Attributes
UniProt ID
Protein Name
Trehalose-6-phosphate synthase
Ligand Name
URIDINE-5'-DIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
XCCTYIAWTASOJW-XVFCMESISA-N
SMILES
C1=CN(C(=O)NC1=O)C2C(C(C(O2)COP(=O)(O)OP(=O)(O)O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 5TVG
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse5tvgA1e5tvgA2e5tvgB1e5tvgB2e5tvgC1e5tvgC2e5tvgD1e5tvgD2e5tvgE1e5tvgE2e5tvgF1e5tvgF2e5tvgG1e5tvgG2e5tvgH1e5tvgH2
ECOD domains from experimental PDB structures interacting with ligand DB03435
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| A4JGS8 | DB03435 | UDP | 5tvg | e5tvgA1 | A:227-463 |
| A4JGS8 | DB03435 | UDP | 5tvg | e5tvgA2 | A:-4-226 |
| A4JGS8 | DB03435 | UDP | 5tvg | e5tvgB1 | B:227-464 |
| A4JGS8 | DB03435 | UDP | 5tvg | e5tvgB2 | B:0-226 |
| A4JGS8 | DB03435 | UDP | 5tvg | e5tvgC1 | C:227-468 |
| A4JGS8 | DB03435 | UDP | 5tvg | e5tvgC2 | C:1-226 |
| A4JGS8 | DB03435 | UDP | 5tvg | e5tvgD1 | D:227-456 |
| A4JGS8 | DB03435 | UDP | 5tvg | e5tvgD2 | D:-3-226 |
| A4JGS8 | DB03435 | UDP | 5tvg | e5tvgE1 | E:1-226 |
| A4JGS8 | DB03435 | UDP | 5tvg | e5tvgE2 | E:227-456 |
| A4JGS8 | DB03435 | UDP | 5tvg | e5tvgF1 | F:1-226 |
| A4JGS8 | DB03435 | UDP | 5tvg | e5tvgF2 | F:227-460 |
| A4JGS8 | DB03435 | UDP | 5tvg | e5tvgG1 | G:227-456 |
| A4JGS8 | DB03435 | UDP | 5tvg | e5tvgG2 | G:2-226 |
| A4JGS8 | DB03435 | UDP | 5tvg | e5tvgH1 | H:227-458 |
| A4JGS8 | DB03435 | UDP | 5tvg | e5tvgH2 | H:2-226 |