Attributes
UniProt ID
Protein Name
Glutathione S-transferase
Ligand Name
GLUTATHIONE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
RWSXRVCMGQZWBV-WDSKDSINSA-N
SMILES
C(CC(=O)NC(CS)C(=O)NCC(=O)O)C(C(=O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 4IVF
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse4ivfA1e4ivfA2e4ivfB1e4ivfB2e4ivfC1e4ivfC2e4ivfD1e4ivfD2e4ivfE1e4ivfE2e4ivfF1e4ivfF2e4ivfG1e4ivfG2e4ivfH1e4ivfH2
ECOD domains from experimental PDB structures interacting with ligand DB00143
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| A5E437 | DB00143 | GSH | 4ivf | e4ivfA1 | A:92-221 |
| A5E437 | DB00143 | GSH | 4ivf | e4ivfA2 | A:1-91 |
| A5E437 | DB00143 | GSH | 4ivf | e4ivfB1 | B:92-218 |
| A5E437 | DB00143 | GSH | 4ivf | e4ivfB2 | B:1-91 |
| A5E437 | DB00143 | GSH | 4ivf | e4ivfC1 | C:92-226 |
| A5E437 | DB00143 | GSH | 4ivf | e4ivfC2 | C:1-91 |
| A5E437 | DB00143 | GSH | 4ivf | e4ivfD1 | D:92-219 |
| A5E437 | DB00143 | GSH | 4ivf | e4ivfD2 | D:1-91 |
| A5E437 | DB00143 | GSH | 4ivf | e4ivfE1 | E:92-226 |
| A5E437 | DB00143 | GSH | 4ivf | e4ivfE2 | E:1-91 |
| A5E437 | DB00143 | GSH | 4ivf | e4ivfF1 | F:96-231 |
| A5E437 | DB00143 | GSH | 4ivf | e4ivfF2 | F:5-95 |
| A5E437 | DB00143 | GSH | 4ivf | e4ivfG1 | G:92-226 |
| A5E437 | DB00143 | GSH | 4ivf | e4ivfG2 | G:1-91 |
| A5E437 | DB00143 | GSH | 4ivf | e4ivfH1 | H:92-218 |
| A5E437 | DB00143 | GSH | 4ivf | e4ivfH2 | H:1-91 |