Attributes
UniProt ID
Protein Name
Succinate dehydrogenase cytochrome b small subunit, mitochondrial
Ligand Name
L-ALPHA-PHOSPHATIDYL-BETA-OLEOYL-GAMMA-PALMITOYL-PHOSPHATIDYLETHANOLAMINE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
MABRTXOVHMDVAT-AAEGOEIASA-N
SMILES
CCCC=CCC=CCCCCCCCC(=O)OC(COC(=O)CCCCCCC=CCCC=CCCC=CC)COP(=O)(O)OCCN
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1ZOY
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1zoyA1e1zoyA4e1zoyA5e1zoyB1e1zoyB2e1zoyC1e1zoyD1
ECOD domains from experimental PDB structures interacting with ligand DB03047
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| A5GZW8 | DB03047 | EPH | 1zoy | e1zoyD1 | D:35-136 |
| A5GZW8 | DB03047 | EPH | 3abv | e3abvD1 | D:35-136 |
| A5GZW8 | DB03047 | EPH | 3ae1 | e3ae1D1 | D:35-136 |
| A5GZW8 | DB03047 | EPH | 3ae2 | e3ae2D1 | D:35-136 |
| A5GZW8 | DB03047 | EPH | 3ae3 | e3ae3D1 | D:35-136 |
| A5GZW8 | DB03047 | EPH | 3ae4 | e3ae4D1 | D:35-136 |
| A5GZW8 | DB03047 | EPH | 3ae5 | e3ae5D1 | D:35-136 |
| A5GZW8 | DB03047 | EPH | 3ae6 | e3ae6D1 | D:35-136 |
| A5GZW8 | DB03047 | EPH | 3ae8 | e3ae8D1 | D:35-136 |
| A5GZW8 | DB03047 | EPH | 3ae9 | e3ae9D1 | D:35-136 |
| A5GZW8 | DB03047 | EPH | 3aea | e3aeaD1 | D:35-136 |
| A5GZW8 | DB03047 | EPH | 3aeb | e3aebD1 | D:35-136 |
| A5GZW8 | DB03047 | EPH | 3aec | e3aecD1 | D:35-136 |
| A5GZW8 | DB03047 | EPH | 3aed | e3aedD1 | D:35-136 |
| A5GZW8 | DB03047 | EPH | 3aef | e3aefD1 | D:35-136 |