Attributes
UniProt ID
Protein Name
Bifunctional dihydrofolate reductase-thymidylate synthase
Ligand Name
2'-DEOXYURIDINE 5'-MONOPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
JSRLJPSBLDHEIO-SHYZEUOFSA-N
SMILES
C1C(C(OC1N2C=CC(=O)NC2=O)COP(=O)(O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 3QGT
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse3qgtA2e3qgtA4e3qgtB2e3qgtB3
ECOD domains from experimental PDB structures interacting with ligand DB03800
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| A7UD81 | DB03800 | UMP | 3qgt | e3qgtA2 | A:283-608 |
| A7UD81 | DB03800 | UMP | 3qgt | e3qgtB3 | B:283-608 |
| A7UD81 | DB03800 | UMP | 3um5 | e3um5A3 | A:283-608 |
| A7UD81 | DB03800 | UMP | 3um5 | e3um5B1 | B:283-608 |
| A7UD81 | DB03800 | UMP | 3um6 | e3um6A1 | A:283-608 |
| A7UD81 | DB03800 | UMP | 3um6 | e3um6B2 | B:283-608 |
| A7UD81 | DB03800 | UMP | 4dpd | e4dpdA1 | A:288-605 |
| A7UD81 | DB03800 | UMP | 4dpd | e4dpdB1 | B:283-605 |
| A7UD81 | DB03800 | UMP | 6a2k | e6a2kA2 | A:283-608 |
| A7UD81 | DB03800 | UMP | 6a2k | e6a2kB2 | B:284-608 |
| A7UD81 | DB03800 | UMP | 6a2m | e6a2mA1 | A:283-604 |
| A7UD81 | DB03800 | UMP | 6a2m | e6a2mB2 | B:283-604 |
| A7UD81 | DB03800 | UMP | 6a2o | e6a2oA2 | A:283-608 |
| A7UD81 | DB03800 | UMP | 6a2o | e6a2oB1 | B:283-608 |
| A7UD81 | DB03800 | UMP | 7ctz | e7ctzA2 | A:284-606 |
| A7UD81 | DB03800 | UMP | 7ctz | e7ctzB2 | B:283-606 |
| A7UD81 | DB03800 | UMP | 7f3y | e7f3yA1 | A:283-608 |
| A7UD81 | DB03800 | UMP | 7f3y | e7f3yB1 | B:284-608 |