Attributes
UniProt ID
Protein Name
PlyP35
Ligand Name
2-acetamido-2-deoxy-beta-D-glucopyranose
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
OVRNDRQMDRJTHS-FMDGEEDCSA-N
SMILES
CC(=O)NC1C(C(C(OC1O)CO)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 6THJ
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse6thjA1e6thjA2e6thjB1e6thjB2e6thjC1e6thjC2e6thjD1e6thjD2e6thjE1e6thjE2e6thjF1e6thjF2e6thjG1e6thjG2e6thjH1e6thjH2e6thjI1e6thjI2e6thjJ1e6thjJ2e6thjK1e6thjK2e6thjL1e6thjL2
ECOD domains from experimental PDB structures interacting with ligand DB00141
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| A8ATR6 | DB00141 | NAG | 6thj | e6thjA1 | A:9-91 |
| A8ATR6 | DB00141 | NAG | 6thj | e6thjB1 | B:10-91 |
| A8ATR6 | DB00141 | NAG | 6thj | e6thjB2 | B:92-146 |
| A8ATR6 | DB00141 | NAG | 6thj | e6thjC1 | C:9-91 |
| A8ATR6 | DB00141 | NAG | 6thj | e6thjD1 | D:9-91 |
| A8ATR6 | DB00141 | NAG | 6thj | e6thjE1 | E:9-91 |
| A8ATR6 | DB00141 | NAG | 6thj | e6thjE2 | E:92-147 |
| A8ATR6 | DB00141 | NAG | 6thj | e6thjF1 | F:9-91 |
| A8ATR6 | DB00141 | NAG | 6thj | e6thjG1 | G:9-91 |
| A8ATR6 | DB00141 | NAG | 6thj | e6thjH1 | H:9-91 |
| A8ATR6 | DB00141 | NAG | 6thj | e6thjI1 | I:10-91 |
| A8ATR6 | DB00141 | NAG | 6thj | e6thjI2 | I:92-147 |
| A8ATR6 | DB00141 | NAG | 6thj | e6thjJ1 | J:9-91 |
| A8ATR6 | DB00141 | NAG | 6thj | e6thjK1 | K:10-91 |
| A8ATR6 | DB00141 | NAG | 6thj | e6thjK2 | K:92-147 |
| A8ATR6 | DB00141 | NAG | 6thj | e6thjL1 | L:10-91 |
| A8ATR6 | DB00141 | NAG | 6thj | e6thjL2 | L:92-147 |