Attributes
UniProt ID
Protein Name
deleted
Ligand Name
N-{[4-({[(6R)-2-amino-5-formyl-4-oxo-1,4,5,6,7,8-hexahydropteridin-6-yl]methyl}amino)phenyl]carbonyl}-L-glutamic acid
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
VVIAGPKUTFNRDU-OLZOCXBDSA-N
SMILES
c1cc(ccc1C(=O)NC(CCC(=O)O)C(=O)O)NCC2CNC3=C(N2C=O)C(=O)N=C(N3)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 4LXQ
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse4lxqA1e4lxqA2e4lxqB1e4lxqB2
ECOD domains from experimental PDB structures interacting with ligand DB03256
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| A8FMJ3 | DB03256 | FON | 4lxq | e4lxqA2 | A:-1-194 |
| A8FMJ3 | DB03256 | FON | 4lxq | e4lxqB1 | B:-1-194 |
| A8FMJ3 | DB03256 | FON | 4lxq | e4lxqB2 | B:195-272 |
| A8FMJ3 | DB03256 | FON | 4lxt | e4lxtA1 | A:195-271 |
| A8FMJ3 | DB03256 | FON | 4lxt | e4lxtA2 | A:-1-194 |
| A8FMJ3 | DB03256 | FON | 4lxt | e4lxtB1 | B:-1-194 |
| A8FMJ3 | DB03256 | FON | 4lxt | e4lxtB2 | B:195-272 |
| A8FMJ3 | DB03256 | FON | 4lxu | e4lxuA1 | A:195-271 |
| A8FMJ3 | DB03256 | FON | 4lxu | e4lxuA2 | A:-1-194 |
| A8FMJ3 | DB03256 | FON | 4lxu | e4lxuB1 | B:195-272 |
| A8FMJ3 | DB03256 | FON | 4lxu | e4lxuB2 | B:-1-194 |
| A8FMJ3 | DB03256 | FON | 4lxx | e4lxxA1 | A:195-271 |
| A8FMJ3 | DB03256 | FON | 4lxx | e4lxxA2 | A:-1-194 |
| A8FMJ3 | DB03256 | FON | 4lxx | e4lxxB1 | B:195-272 |
| A8FMJ3 | DB03256 | FON | 4lxx | e4lxxB2 | B:-1-194 |