Attributes
UniProt ID
Protein Name
Bifunctional dethiobiotin synthetase/7,8-diamino-pelargonic acid aminotransferase, mitochondrial
Ligand Name
PYRIDOXAL-5'-PHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
NGVDGCNFYWLIFO-UHFFFAOYSA-N
SMILES
Cc1c(c(c(cn1)COP(=O)(O)O)C=O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 4A0F
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse4a0fA1e4a0fA2e4a0fA3e4a0fB1e4a0fB2e4a0fB3
ECOD domains from experimental PDB structures interacting with ligand DB00114
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| B0F481 | DB00114 | PLP | 4a0f | e4a0fA2 | A:364-703 |
| B0F481 | DB00114 | PLP | 4a0f | e4a0fB1 | B:661-808 |
| B0F481 | DB00114 | PLP | 4a0f | e4a0fB3 | B:345-660 |
| B0F481 | DB00114 | PLP | 4a0g | e4a0gA2 | A:364-703 |
| B0F481 | DB00114 | PLP | 4a0g | e4a0gB1 | B:364-703 |
| B0F481 | DB00114 | PLP | 4a0g | e4a0gC3 | C:364-476,C:502-521,C:546-703 |
| B0F481 | DB00114 | PLP | 4a0g | e4a0gD1 | D:661-807 |
| B0F481 | DB00114 | PLP | 4a0g | e4a0gD3 | D:345-660 |
| B0F481 | DB00114 | PLP | 4a0h | e4a0hA1 | A:661-807 |
| B0F481 | DB00114 | PLP | 4a0h | e4a0hA3 | A:345-660 |
| B0F481 | DB00114 | PLP | 4a0h | e4a0hB1 | B:661-807 |
| B0F481 | DB00114 | PLP | 4a0h | e4a0hB3 | B:345-660 |
| B0F481 | DB00114 | PLP | 4a0r | e4a0rA1 | A:661-809 |
| B0F481 | DB00114 | PLP | 4a0r | e4a0rA3 | A:345-660 |
| B0F481 | DB00114 | PLP | 4a0r | e4a0rB1 | B:661-807 |
| B0F481 | DB00114 | PLP | 4a0r | e4a0rB3 | B:345-660 |