Attributes
UniProt ID
Protein Name
Putrescine oxidase
Ligand Name
FLAVIN-ADENINE DINUCLEOTIDE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
VWWQXMAJTJZDQX-UYBVJOGSSA-N
SMILES
Cc1cc2c(cc1C)N(C3=NC(=O)NC(=O)C3=N2)CC(C(C(COP(=O)(O)OP(=O)(O)OCC4C(C(C(O4)n5cnc6c5ncnc6N)O)O)O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 2YG3
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse2yg3A1e2yg3A2e2yg3B1e2yg3B2
ECOD domains from experimental PDB structures interacting with ligand DB03147
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| B0F9F6 | DB03147 | FAD | 2yg3 | e2yg3A1 | A:282-390 |
| B0F9F6 | DB03147 | FAD | 2yg3 | e2yg3A2 | A:2-281,A:391-450 |
| B0F9F6 | DB03147 | FAD | 2yg3 | e2yg3B1 | B:282-390 |
| B0F9F6 | DB03147 | FAD | 2yg3 | e2yg3B2 | B:2-281,B:391-451 |
| B0F9F6 | DB03147 | FAD | 2yg4 | e2yg4A1 | A:282-390 |
| B0F9F6 | DB03147 | FAD | 2yg4 | e2yg4A2 | A:2-281,A:391-450 |
| B0F9F6 | DB03147 | FAD | 2yg4 | e2yg4B1 | B:282-390 |
| B0F9F6 | DB03147 | FAD | 2yg4 | e2yg4B2 | B:2-281,B:391-451 |
| B0F9F6 | DB03147 | FAD | 2yg5 | e2yg5A1 | A:282-390 |
| B0F9F6 | DB03147 | FAD | 2yg5 | e2yg5A2 | A:2-281,A:391-451 |
| B0F9F6 | DB03147 | FAD | 2yg6 | e2yg6A1 | A:282-390 |
| B0F9F6 | DB03147 | FAD | 2yg6 | e2yg6A2 | A:2-281,A:391-450 |
| B0F9F6 | DB03147 | FAD | 2yg6 | e2yg6B1 | B:282-390 |
| B0F9F6 | DB03147 | FAD | 2yg6 | e2yg6B2 | B:2-281,B:391-451 |
| B0F9F6 | DB03147 | FAD | 2yg7 | e2yg7A1 | A:282-390 |
| B0F9F6 | DB03147 | FAD | 2yg7 | e2yg7A2 | A:2-281,A:391-451 |
| B0F9F6 | DB03147 | FAD | 2yg7 | e2yg7B1 | B:282-390 |
| B0F9F6 | DB03147 | FAD | 2yg7 | e2yg7B2 | B:2-281,B:391-451 |