Attributes
UniProt ID
Protein Name
Putative D-lactate dehydrogenase
Ligand Name
NICOTINAMIDE-ADENINE-DINUCLEOTIDE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
BAWFJGJZGIEFAR-NNYOXOHSSA-N
SMILES
c1cc(c[n+](c1)C2C(C(C(O2)COP(=O)([O-])OP(=O)(O)OCC3C(C(C(O3)n4cnc5c4ncnc5N)O)O)O)O)C(=O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 4ZGS
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse4zgsA1e4zgsA2e4zgsB1e4zgsB2e4zgsC1e4zgsC2e4zgsD1e4zgsD2e4zgsE1e4zgsE2e4zgsF1e4zgsF2e4zgsG1e4zgsG2e4zgsH1e4zgsH2
ECOD domains from experimental PDB structures interacting with ligand DB14128
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| B0LUZ5 | DB14128 | NAD | 4zgs | e4zgsA1 | A:135-339 |
| B0LUZ5 | DB14128 | NAD | 4zgs | e4zgsA2 | A:25-134,A:340-370 |
| B0LUZ5 | DB14128 | NAD | 4zgs | e4zgsB1 | B:29-134,B:340-366 |
| B0LUZ5 | DB14128 | NAD | 4zgs | e4zgsB2 | B:135-339 |
| B0LUZ5 | DB14128 | NAD | 4zgs | e4zgsC1 | C:135-339 |
| B0LUZ5 | DB14128 | NAD | 4zgs | e4zgsC2 | C:26-134,C:340-367 |
| B0LUZ5 | DB14128 | NAD | 4zgs | e4zgsD1 | D:135-339 |
| B0LUZ5 | DB14128 | NAD | 4zgs | e4zgsD2 | D:22-134,D:340-367 |
| B0LUZ5 | DB14128 | NAD | 4zgs | e4zgsE1 | E:135-339 |
| B0LUZ5 | DB14128 | NAD | 4zgs | e4zgsE2 | E:24-134,E:340-367 |
| B0LUZ5 | DB14128 | NAD | 4zgs | e4zgsF1 | F:135-339 |
| B0LUZ5 | DB14128 | NAD | 4zgs | e4zgsF2 | F:26-134,F:340-368 |
| B0LUZ5 | DB14128 | NAD | 4zgs | e4zgsG1 | G:135-339 |
| B0LUZ5 | DB14128 | NAD | 4zgs | e4zgsG2 | G:26-134,G:340-368 |
| B0LUZ5 | DB14128 | NAD | 4zgs | e4zgsH1 | H:135-339 |
| B0LUZ5 | DB14128 | NAD | 4zgs | e4zgsH2 | H:25-134,H:340-367 |