Attributes
UniProt ID
Protein Name
Ara h 8 allergen isoform
Ligand Name
8-ANILINO-1-NAPHTHALENE SULFONATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
FWEOQOXTVHGIFQ-UHFFFAOYSA-N
SMILES
c1ccc(cc1)Nc2cccc3c2c(ccc3)S(=O)(=O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 6V8M
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse6v8mA1e6v8mB1
ECOD domains from experimental PDB structures interacting with ligand DB04474
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| B0YIU5 | DB04474 | 2AN | 6v8m | e6v8mA1 | A:2-153 |
| B0YIU5 | DB04474 | 2AN | 6v8m | e6v8mB1 | B:2-153 |
| B0YIU5 | DB04474 | 2AN | 6v8s | e6v8sA1 | A:2-153 |
| B0YIU5 | DB04474 | 2AN | 6v8s | e6v8sB1 | B:2-153 |
| B0YIU5 | DB04474 | 2AN | 6v8s | e6v8sC1 | C:2-153 |
| B0YIU5 | DB04474 | 2AN | 6v8s | e6v8sD1 | D:2-153 |
| B0YIU5 | DB04474 | 2AN | 6v8s | e6v8sE1 | E:2-153 |
| B0YIU5 | DB04474 | 2AN | 6v8s | e6v8sF1 | F:2-153 |
| B0YIU5 | DB04474 | 2AN | 6v8s | e6v8sG1 | G:2-153 |
| B0YIU5 | DB04474 | 2AN | 6v8s | e6v8sH1 | H:2-153 |
| B0YIU5 | DB04474 | 2AN | 6v8s | e6v8sI1 | I:2-153 |
| B0YIU5 | DB04474 | 2AN | 6v8s | e6v8sJ1 | J:2-153 |
| B0YIU5 | DB04474 | 2AN | 6v8s | e6v8sK1 | K:2-153 |
| B0YIU5 | DB04474 | 2AN | 6v8s | e6v8sL1 | L:2-153 |
| B0YIU5 | DB04474 | 2AN | 6v8s | e6v8sM1 | M:2-153 |
| B0YIU5 | DB04474 | 2AN | 6v8s | e6v8sN1 | N:2-153 |
| B0YIU5 | DB04474 | 2AN | 6v8s | e6v8sO1 | O:2-153 |
| B0YIU5 | DB04474 | 2AN | 6v8s | e6v8sP1 | P:2-153 |