Attributes
UniProt ID
Protein Name
Possible 4'-phosphopantetheinyl transferase
Ligand Name
COENZYME A
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
RGJOEKWQDUBAIZ-IBOSZNHHSA-N
SMILES
CC(C)(COP(=O)(O)OP(=O)(O)OCC1C(C(C(O1)n2cnc3c2ncnc3N)O)OP(=O)(O)O)C(C(=O)NCCC(=O)NCCS)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 6QWU
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse6qwuA1e6qwuA2
ECOD domains from experimental PDB structures interacting with ligand DB01992
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| B1MD73 | DB01992 | COA | 6qwu | e6qwuA1 | A:4-26,A:104-222 |
| B1MD73 | DB01992 | COA | 6qwu | e6qwuA2 | A:27-103 |
| B1MD73 | DB01992 | COA | 6qxq | e6qxqA1 | A:27-103 |
| B1MD73 | DB01992 | COA | 6qxq | e6qxqA2 | A:5-26,A:104-222 |
| B1MD73 | DB01992 | COA | 6qxr | e6qxrA1 | A:5-26,A:104-224 |
| B1MD73 | DB01992 | COA | 6qxr | e6qxrA2 | A:27-103 |
| B1MD73 | DB01992 | COA | 6qyf | e6qyfA1 | A:27-103 |
| B1MD73 | DB01992 | COA | 6qyf | e6qyfA2 | A:5-26,A:104-222 |
| B1MD73 | DB01992 | COA | 6qyg | e6qygA1 | A:27-103 |
| B1MD73 | DB01992 | COA | 6qyg | e6qygA2 | A:5-26,A:104-223 |
| B1MD73 | DB01992 | COA | 6rcx | e6rcxA1 | A:27-103 |
| B1MD73 | DB01992 | COA | 6rcx | e6rcxA2 | A:4-26,A:104-220 |
| B1MD73 | DB01992 | COA | 7b4r | e7b4rA1 | A:103-221 |
| B1MD73 | DB01992 | COA | 7b4r | e7b4rA2 | A:5-102 |
| B1MD73 | DB01992 | COA | 7b4s | e7b4sA1 | A:105-221 |
| B1MD73 | DB01992 | COA | 7b4s | e7b4sA2 | A:5-104 |
| B1MD73 | DB01992 | COA | 7bdw | e7bdwA1 | A:103-221 |
| B1MD73 | DB01992 | COA | 7bdw | e7bdwA2 | A:4-102 |