Attributes
UniProt ID
Protein Name
Monooxygenase
Ligand Name
FLAVIN-ADENINE DINUCLEOTIDE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
VWWQXMAJTJZDQX-UYBVJOGSSA-N
SMILES
Cc1cc2c(cc1C)N(C3=NC(=O)NC(=O)C3=N2)CC(C(C(COP(=O)(O)OP(=O)(O)OCC4C(C(C(O4)n5cnc6c5ncnc6N)O)O)O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 4A9W
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse4a9wA1e4a9wA2e4a9wB1e4a9wB2
ECOD domains from experimental PDB structures interacting with ligand DB03147
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| B2FRL2 | DB03147 | FAD | 4a9w | e4a9wA1 | A:140-204,A:238-284 |
| B2FRL2 | DB03147 | FAD | 4a9w | e4a9wA2 | A:1-139,A:285-352 |
| B2FRL2 | DB03147 | FAD | 4a9w | e4a9wB1 | B:140-204,B:238-284 |
| B2FRL2 | DB03147 | FAD | 4a9w | e4a9wB2 | B:1-139,B:285-352 |
| B2FRL2 | DB03147 | FAD | 4c5o | e4c5oA1 | A:1-139,A:285-352 |
| B2FRL2 | DB03147 | FAD | 4c5o | e4c5oA2 | A:140-204,A:238-284 |
| B2FRL2 | DB03147 | FAD | 4c5o | e4c5oB1 | B:1-139,B:285-352 |
| B2FRL2 | DB03147 | FAD | 4c5o | e4c5oB2 | B:140-204,B:238-284 |
| B2FRL2 | DB03147 | FAD | 4c5o | e4c5oC1 | C:140-204,C:238-284 |
| B2FRL2 | DB03147 | FAD | 4c5o | e4c5oC2 | C:1-139,C:285-352 |
| B2FRL2 | DB03147 | FAD | 4c5o | e4c5oD1 | D:140-204,D:238-284 |
| B2FRL2 | DB03147 | FAD | 4c5o | e4c5oD2 | D:1-139,D:285-352 |
| B2FRL2 | DB03147 | FAD | 4c5o | e4c5oE1 | E:140-204,E:238-284 |
| B2FRL2 | DB03147 | FAD | 4c5o | e4c5oE2 | E:1-139,E:285-352 |
| B2FRL2 | DB03147 | FAD | 4c5o | e4c5oF1 | F:140-204,F:238-284 |
| B2FRL2 | DB03147 | FAD | 4c5o | e4c5oF2 | F:1-139,F:285-352 |
| B2FRL2 | DB03147 | FAD | 4c5o | e4c5oG1 | G:140-204,G:238-284 |
| B2FRL2 | DB03147 | FAD | 4c5o | e4c5oG2 | G:1-139,G:285-352 |
| B2FRL2 | DB03147 | FAD | 4c5o | e4c5oH1 | H:140-212,H:234-284 |
| B2FRL2 | DB03147 | FAD | 4c5o | e4c5oH2 | H:1-139,H:285-352 |