Attributes
UniProt ID
Protein Name
deleted
Ligand Name
(DIPHOSPHONO)AMINOPHOSPHONIC ACID
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
PELPUMGXMYVGSQ-UHFFFAOYSA-N
SMILES
N(P(=O)(O)O)P(=O)(O)OP(=O)(O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 6RKC
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse6rkcA1e6rkcA2e6rkcA3e6rkcB1e6rkcB2e6rkcB3e6rkcC1e6rkcC2e6rkcC3e6rkcD1e6rkcD2e6rkcD3e6rkcE1e6rkcE2e6rkcE3e6rkcF1e6rkcF2e6rkcF3e6rkcG1e6rkcG2e6rkcG3e6rkcH1e6rkcH2e6rkcH3
ECOD domains from experimental PDB structures interacting with ligand DB03075
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| B2NE58 | DB03075 | PPK | 6rkc | e6rkcA1 | A:225-375 |
| B2NE58 | DB03075 | PPK | 6rkc | e6rkcA2 | A:103-224 |
| B2NE58 | DB03075 | PPK | 6rkc | e6rkcA3 | A:4-102 |
| B2NE58 | DB03075 | PPK | 6rkc | e6rkcB1 | B:225-377 |
| B2NE58 | DB03075 | PPK | 6rkc | e6rkcB2 | B:4-102 |
| B2NE58 | DB03075 | PPK | 6rkc | e6rkcB3 | B:103-224 |
| B2NE58 | DB03075 | PPK | 6rkc | e6rkcC1 | C:3-102 |
| B2NE58 | DB03075 | PPK | 6rkc | e6rkcC2 | C:103-224 |
| B2NE58 | DB03075 | PPK | 6rkc | e6rkcC3 | C:225-375 |
| B2NE58 | DB03075 | PPK | 6rkc | e6rkcD1 | D:225-375 |
| B2NE58 | DB03075 | PPK | 6rkc | e6rkcD2 | D:4-102 |
| B2NE58 | DB03075 | PPK | 6rkc | e6rkcD3 | D:103-224 |
| B2NE58 | DB03075 | PPK | 6rkc | e6rkcE1 | E:4-102 |
| B2NE58 | DB03075 | PPK | 6rkc | e6rkcE2 | E:225-375 |
| B2NE58 | DB03075 | PPK | 6rkc | e6rkcE3 | E:103-224 |
| B2NE58 | DB03075 | PPK | 6rkc | e6rkcF1 | F:4-102 |
| B2NE58 | DB03075 | PPK | 6rkc | e6rkcF2 | F:225-377 |
| B2NE58 | DB03075 | PPK | 6rkc | e6rkcF3 | F:103-224 |
| B2NE58 | DB03075 | PPK | 6rkc | e6rkcG1 | G:103-224 |
| B2NE58 | DB03075 | PPK | 6rkc | e6rkcG2 | G:3-102 |
| B2NE58 | DB03075 | PPK | 6rkc | e6rkcG3 | G:225-375 |
| B2NE58 | DB03075 | PPK | 6rkc | e6rkcH1 | H:225-375 |
| B2NE58 | DB03075 | PPK | 6rkc | e6rkcH2 | H:4-102 |
| B2NE58 | DB03075 | PPK | 6rkc | e6rkcH3 | H:103-224 |