Attributes
UniProt ID
Protein Name
Pantothenate kinase
Ligand Name
ADENOSINE-5'-DIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
XTWYTFMLZFPYCI-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 4F7W
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse4f7wA1e4f7wB1e4f7wC1e4f7wD1e4f7wE1e4f7wF1e4f7wG1e4f7wH1
ECOD domains from experimental PDB structures interacting with ligand DB16833
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| B5XYG3 | DB16833 | ADP | 4f7w | e4f7wA1 | A:1008-1316 |
| B5XYG3 | DB16833 | ADP | 4f7w | e4f7wB1 | B:1008-1316 |
| B5XYG3 | DB16833 | ADP | 4f7w | e4f7wC1 | C:983-1291 |
| B5XYG3 | DB16833 | ADP | 4f7w | e4f7wD1 | D:983-1290 |
| B5XYG3 | DB16833 | ADP | 4f7w | e4f7wE1 | E:1008-1316 |
| B5XYG3 | DB16833 | ADP | 4f7w | e4f7wF1 | F:983-1291 |
| B5XYG3 | DB16833 | ADP | 4f7w | e4f7wG1 | G:983-1290 |
| B5XYG3 | DB16833 | ADP | 4f7w | e4f7wH1 | H:1008-1316 |
| B5XYG3 | DB16833 | ADP | 4gi7 | e4gi7A1 | A:983-1291 |
| B5XYG3 | DB16833 | ADP | 4gi7 | e4gi7B1 | B:983-1291 |
| B5XYG3 | DB16833 | ADP | 4gi7 | e4gi7C1 | C:983-1291 |
| B5XYG3 | DB16833 | ADP | 4gi7 | e4gi7D1 | D:983-1290 |
| B5XYG3 | DB16833 | ADP | 4gi7 | e4gi7E1 | E:1008-1316 |
| B5XYG3 | DB16833 | ADP | 4gi7 | e4gi7F1 | F:983-1291 |
| B5XYG3 | DB16833 | ADP | 4gi7 | e4gi7G1 | G:983-1290 |
| B5XYG3 | DB16833 | ADP | 4gi7 | e4gi7H1 | H:1008-1316 |
| B5XYG3 | DB16833 | ADP | 4ne2 | e4ne2A1 | A:8-316 |
| B5XYG3 | DB16833 | ADP | 4ne2 | e4ne2B1 | B:9-316 |